DL-INDOLE-3-LACTIC ACID manufacturers
|
| | DL-INDOLE-3-LACTIC ACID Basic information |
| | DL-INDOLE-3-LACTIC ACID Chemical Properties |
| Melting point | 145-146 °C(lit.) | | storage temp. | 2-8°C | | form | Crystalline Powder | | color | White to brown | | InChI | 1S/C11H11NO3/c13-10(11(14)15)5-7-6-12-9-4-2-1-3-8(7)9/h1-4,6,10,12-13H,5H2,(H,14,15) | | InChIKey | XGILAAMKEQUXLS-UHFFFAOYSA-N | | SMILES | OC(Cc1c[nH]c2ccccc12)C(O)=O |
| WGK Germany | 3 | | HS Code | 29339980 | | Storage Class | 11 - Combustible Solids |
| | DL-INDOLE-3-LACTIC ACID Usage And Synthesis |
| Chemical Properties | White to brown crystalline powder | | Uses | Reactant for preparation of:• ;Antibacterial agents1• ;Dietary sweetener2 | | Uses | Reactant for preparation of:
- Antibacterial agents
- Dietary sweetener
| | Definition | ChEBI: 3-(indol-3-yl)lactic acid is a hydroxy monocarboxylic acid that is lactic acid substituted by a 1H-indol-3-yl group at position 3. It is a metabolite of tryptophan. It has a role as a human metabolite. It is an indol-3-yl carboxylic acid and a hydroxy monocarboxylic acid. It is functionally related to a rac-lactic acid. It is a conjugate acid of a 3-(indol-3-yl)lactate. |
| | DL-INDOLE-3-LACTIC ACID Preparation Products And Raw materials |
|