|
|
| | TRIELAIDIN Basic information |
| Product Name: | TRIELAIDIN | | Synonyms: | GLYCEROL 1,2,3-TRI(TRANS-9-OCTADECENOATE);GLYCEROL ELAIDATE;GLYCERYL TRIELAIDATE;C18:1,[TRANS]-9;ELAIDIN;DELTA 9 TRANS TRIELAIDIN;TRIELAIDIN;1),(trans)-9 | | CAS: | 537-39-3 | | MF: | C57H104O6 | | MW: | 885.43 | | EINECS: | 208-665-0 | | Product Categories: | | | Mol File: | 537-39-3.mol |  |
| | TRIELAIDIN Chemical Properties |
| Melting point | 42°C | | Boiling point | 720.29°C (rough estimate) | | density | 0.9028 (rough estimate) | | refractive index | 1.4381 (estimate) | | storage temp. | −20°C | | solubility | almost transparency in Toluene | | form | powder to crystal | | color | White to Almost white | | biological source | plant oil (sunflower) | | InChIKey | PHYFQTYBJUILEZ-WUOFIQDXSA-N | | SMILES | CCCCCCCC\C=C\CCCCCCCC(=O)OCC(COC(=O)CCCCCCC\C=C\CCCCCCCC)OC(=O)CCCCCCC\C=C\CCCCCCCC |
| WGK Germany | - | | HS Code | 2916.19.5000 | | Storage Class | 11 - Combustible Solids |
| | TRIELAIDIN Usage And Synthesis |
| Uses | Trielaidin is a component of partially hydrogenated vegetable oils. | | Definition | ChEBI: A triglyceride formed by esterification of the three hydroxy groups of glycerol with elaidic acid. |
| | TRIELAIDIN Preparation Products And Raw materials |
|