|
|
| | 4,5-DIPHENYL-2-IMIDAZOLETHIOL Basic information |
| Product Name: | 4,5-DIPHENYL-2-IMIDAZOLETHIOL | | Synonyms: | 4,5-DIPHENYL-1H-IMIDAZOLE-2-THIOL;4,5-DIPHENYL-2-IMIDAZOLETHIOL;4,5-DIPHENYL-1H-IMIDAZOL-2-YLHYDROSULFIDE;1,3-dihydro-4,5-diphenyl-2H-imidazole-2-thione;4,5-Diphenyl-2-imidazolethiol, HPLC 97%;4,5-DIPHENYL-2-IMIDAZOLETHIOL 97%;TIMTEC-BB SBB000919;4,5-Diphenyl-4-imidazoline-2-thione | | CAS: | 2349-58-8 | | MF: | C15H12N2S | | MW: | 252.33 | | EINECS: | 219-077-9 | | Product Categories: | Building Blocks;Heterocyclic Building Blocks;Imidazoles | | Mol File: | 2349-58-8.mol |  |
| | 4,5-DIPHENYL-2-IMIDAZOLETHIOL Chemical Properties |
| Melting point | >300 °C (lit.) | | Boiling point | 407.5±55.0 °C(Predicted) | | density | 1.1917 (rough estimate) | | refractive index | 1.6000 (estimate) | | form | solid | | pka | 10.17±0.70(Predicted) | | BRN | 187613 | | InChI | 1S/C15H12N2S/c18-15-16-13(11-7-3-1-4-8-11)14(17-15)12-9-5-2-6-10-12/h1-10H,(H2,16,17,18) | | InChIKey | GMTAWLUJHGIUPU-UHFFFAOYSA-N | | SMILES | Sc1nc(-c2ccccc2)c([nH]1)-c3ccccc3 | | CAS DataBase Reference | 2349-58-8(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29332990 | | Storage Class | 11 - Combustible Solids |
| | 4,5-DIPHENYL-2-IMIDAZOLETHIOL Usage And Synthesis |
| Chemical Properties | white to light yellow fine crystalline powder | | Uses | 4,5-Diphenyl-2-imidazolethiol may be used in chemical synthesis studies. |
| | 4,5-DIPHENYL-2-IMIDAZOLETHIOL Preparation Products And Raw materials |
|