|
|
| | CYCLO(-GLY-PHE) Basic information |
| Product Name: | CYCLO(-GLY-PHE) | | Synonyms: | CYCLO(GLY-L-PHE);CYCLO(-GLY-PHE);(S)-3-Benzyl-2,5-piperazinedione;Cyclo(glycyl-L-phenylalanyl);(S)-3-Benzylpiperazine-2,5-dione;Cyclo(-Gly-L-Phe)≥ 99% (HPLC);2,5-Piperazinedione, 3-(phenylmethyl)-, (3S)-;c(Gly-Phe) | | CAS: | 10125-07-2 | | MF: | C11H12N2O2 | | MW: | 204.23 | | EINECS: | | | Product Categories: | | | Mol File: | 10125-07-2.mol |  |
| | CYCLO(-GLY-PHE) Chemical Properties |
| Melting point | 266-268℃ | | Boiling point | 535.1±43.0 °C(Predicted) | | density | 1.202 | | storage temp. | -15°C | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | 13.18±0.40(Predicted) | | color | White | | InChI | 1S/C11H12N2O2/c14-10-7-12-11(15)9(13-10)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,12,15)(H,13,14)/t9-/m0/s1 | | InChIKey | UZOJHXFWJFSFAI-VIFPVBQESA-N | | SMILES | O=C1CNC(=O)[C@H](Cc2ccccc2)N1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | CYCLO(-GLY-PHE) Usage And Synthesis |
| Chemical Properties | White solid | | Uses | Cyclo(-Gly-Phe) is used to study the thermodynamics of protein unfolding. It is also able to cause gelation in a wide variety of organic fluids, including edible oils, glyceryl esters, alcohols, and aromatic molecules. |
| | CYCLO(-GLY-PHE) Preparation Products And Raw materials |
|