|
|
| | 3-FLUORO-5-NITROBENZOTRIFLUORIDE Basic information |
| Product Name: | 3-FLUORO-5-NITROBENZOTRIFLUORIDE | | Synonyms: | 3-FLUORO-5-NITRO-1-TRIFLUOROMETHYLBENZENE;3-FLUORO-5-NITROBENZOTRIFLUORIDE;3-Fluoro-5-(trifluoromethyl)nitrobenzene;3-FLUORO-5-NITRO-1-TRIFLUOROMETHYLBENZENE 98%;3-Fuoro-5-nitrobenzotrifluoride;1-Fluoro-3-nitro-5-(trifluoroMethyl)benzene;Benzene, 1-fluoro-3-nitro-5-(trifluoroMethyl)-;3-fluoro-5-nitrobenzotrifluoride
3-Fluoro-5-(trifluoromethyl)nitrobenzene | | CAS: | 454-73-9 | | MF: | C7H3F4NO2 | | MW: | 209.1 | | EINECS: | | | Product Categories: | Fluorine series | | Mol File: | 454-73-9.mol |  |
| | 3-FLUORO-5-NITROBENZOTRIFLUORIDE Chemical Properties |
| Boiling point | 180.5 °C | | density | 1.504±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform, Methanol | | form | Oil | | color | Clear Pale Yellow | | InChI | InChI=1S/C7H3F4NO2/c8-5-1-4(7(9,10)11)2-6(3-5)12(13)14/h1-3H | | InChIKey | RKLBCPTURHSIOJ-UHFFFAOYSA-N | | SMILES | C1(F)=CC(C(F)(F)F)=CC([N+]([O-])=O)=C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | Hazard Note | Irritant | | HS Code | 2904990090 |
| | 3-FLUORO-5-NITROBENZOTRIFLUORIDE Usage And Synthesis |
| Uses | 3-Fluoro-5-nitrobenzotrifluoride, is a tri-substitiuted benzene derivative used in the preparation of androgen receptor modulators and other pharmaceutical compounds. |
| | 3-FLUORO-5-NITROBENZOTRIFLUORIDE Preparation Products And Raw materials |
|