|
|
| | 2,4-Dimethoxy-5-fluoronitrobenzene Basic information |
| | 2,4-Dimethoxy-5-fluoronitrobenzene Chemical Properties |
| Melting point | 151-153°C | | Boiling point | 321.6±37.0 °C(Predicted) | | density | 1.310±0.06 g/cm3(Predicted) | | storage temp. | Store at Room Tem. | | form | solid | | InChI | 1S/C8H8FNO4/c1-13-7-4-8(14-2)6(10(11)12)3-5(7)9/h3-4H,1-2H3 | | InChIKey | KADJLLXINJRFKF-UHFFFAOYSA-N | | SMILES | Fc1c(cc(c(c1)[N+](=O)[O-])OC)OC |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT, CORROSIVE | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2,4-Dimethoxy-5-fluoronitrobenzene Usage And Synthesis |
| | 2,4-Dimethoxy-5-fluoronitrobenzene Preparation Products And Raw materials |
|