|
|
| | 2,4-Di-tert-amylphenol Basic information |
| Product Name: | 2,4-Di-tert-amylphenol | | Synonyms: | 2,4-bis(1,1-dimethylpropyl)-pheno;2,4-di-tert-pentyl-pheno;2,4-di-tert-Pentylphenyl;Di-tert-amylphenol;Phenol, 2,4-bis(1,1-dimethylpropyl)-;Phenol, 2,4-di-tert-pentyl-;2,4-Di-tert-amylphenol;Phenol,2,4-bis(1,1-dimethylpropyl | | CAS: | 120-95-6 | | MF: | C16H26O | | MW: | 234.38 | | EINECS: | 204-439-0 | | Product Categories: | Building Blocks;C9 to C20+;Chemical Synthesis;Organic Building Blocks;Oxygen Compounds;Organic Building Blocks;Oxygen Compounds;Phenols;Industrial/Fine Chemicals | | Mol File: | 120-95-6.mol |  |
| | 2,4-Di-tert-amylphenol Chemical Properties |
| Melting point | 25 °C (lit.) | | Boiling point | 169-170 °C/22 mmHg (lit.) | | density | 0.930 g/mL at 25 °C (lit.) | | refractive index | 1.506-1.508 | | Fp | >230 °F | | storage temp. | 2-8°C | | form | powder to lump to clear liquid | | pka | 11.00±0.31(Predicted) | | color | White or Colorless to Almost white or Almost colorless | | Water Solubility | 3mg/L at 21℃ | | InChI | InChI=1S/C16H26O/c1-7-15(3,4)12-9-10-14(17)13(11-12)16(5,6)8-2/h9-11,17H,7-8H2,1-6H3 | | InChIKey | WMVJWKURWRGJCI-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(C(C)(C)CC)C=C1C(C)(C)CC | | LogP | 6.3 at 22℃ | | CAS DataBase Reference | 120-95-6(CAS DataBase Reference) | | NIST Chemistry Reference | 2,4-Di-tert-amyl phenol(120-95-6) | | EPA Substance Registry System | 2,4-Di-tert-amylphenol (120-95-6) |
| Hazard Codes | Xn | | Risk Statements | 22-36-36/38 | | Safety Statements | 26-37/39 | | RIDADR | 3077 | | WGK Germany | 2 | | RTECS | SL3500000 | | TSCA | TSCA listed | | HazardClass | 9 | | PackingGroup | III | | HS Code | 29071990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 | | Hazardous Substances Data | 120-95-6(Hazardous Substances Data) |
| | 2,4-Di-tert-amylphenol Usage And Synthesis |
| Chemical Properties | clear yellow liquid after melting | | Uses | UV Stabilizer Intermediate, Photographic Developers, Specialty Surfactants, Fuel Additive Intermediate | | Uses | 2,4-Di-tert-amylphenol is a phenolic compound, used for the laccase induced coupling reactions. It may be used in the synthesis of Cu-phthalocyanine-C60. | | General Description | The standard molar enthalpies of sublimation (or vaporization) of 2,4-di-tert-amylphenol have been evaluated. Preparation of 2,4-di-tert-amylphenol, via catalytic alkylation of phenol with trimethylethylene, is reported. | | Safety Profile | Poison by ingestion. An
eye irritant. When heated to decomposition
it emits acrid smoke and irritating fumes.
See also PHENOL. |
| | 2,4-Di-tert-amylphenol Preparation Products And Raw materials |
|