2,6-Diamino-4-chloropyrimidine 1-oxide manufacturers
|
| | 2,6-Diamino-4-chloropyrimidine 1-oxide Basic information |
| | 2,6-Diamino-4-chloropyrimidine 1-oxide Chemical Properties |
| Melting point | 185 °C (dec.) (lit.) | | Boiling point | 506.5±53.0 °C(Predicted) | | density | 1.91±0.1 g/cm3(Predicted) | | vapor pressure | 0.001Pa at 25℃ | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | solubility | DMSO (Slightly), Dichloromethane (Slightly), Methanol (Slightly) | | form | Solid:particulate/powder | | pka | 1.67±0.10(Predicted) | | Appearance | White to off-white Solid | | Stability: | Light Sensitive | | InChI | InChI=1S/C4H5ClN4O/c5-2-1-3(6)9(10)4(7)8-2/h1H,6H2,(H2,7,8) | | InChIKey | CFHPTZFRFWGDPD-UHFFFAOYSA-N | | SMILES | C1(N)=NC(Cl)=CC(N)=[N+]1[O-] | | LogP | 0.18-0.46 | | CAS DataBase Reference | 35139-67-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,6-Diamino-4-chloropyrimidine 1-oxide Usage And Synthesis |
| Uses | 6-Chloro-pyrimidine-2,4-diamine 3-Oxide is an impurity of the antihypertensive and antialopecia agent Minoxidil (M345000). | | Uses | 6-Chloro-pyrimidine-2,4-diamine 3-Oxide (Minoxidil EP Impurity A) is an impurity of the antihypertensive and antialopecia agent Minoxidil (M345000). |
| | 2,6-Diamino-4-chloropyrimidine 1-oxide Preparation Products And Raw materials |
|