|
|
| | N10-(TRIFLUOROACETYL)PTEROIC ACID Basic information |
| Product Name: | N10-(TRIFLUOROACETYL)PTEROIC ACID | | Synonyms: | N10-(TRIFLUOROACETYL)PTEROIC ACID;TRIFLUOROACETYLPTEROIC ACID;N(sup 10)-(trifluoroacetyl)pteroic acid;4-[(2-amino-4-oxo-1H-pteridin-6-yl)methyl-(2,2,2-trifluoroacetyl)amino]benzoic acid;4-[[(2-Amino-1,4-dihydro-4-oxo-6-pteridinyl)methyl](trifluoroacetyl)amino]benzoic acid;Benzoic acid,4-[[(2-aMino-3,4-dihydro-4-oxo-6-pteridinyl)Methyl](2,2,2-trifluoroacetyl)aMino]-;N10-(Trifluoroacetyl)pteroic acid 95%;4-[[(2-amino-3,4-dihydro-4-oxo-6-pteridinyl)methyl](2,2,2-trifluoroacetyl)amino]-Benzoic acid | | CAS: | 37793-53-6 | | MF: | C16H11F3N6O4 | | MW: | 408.29 | | EINECS: | | | Product Categories: | Building Blocks;Heterocyclic Building Blocks;Quinazolines | | Mol File: | 37793-53-6.mol |  |
| | N10-(TRIFLUOROACETYL)PTEROIC ACID Chemical Properties |
| Melting point | 270 °C (dec.)(lit.) | | Boiling point | 575.0±60.0 °C(Predicted) | | density | 1.74±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMF (Slightly), DMSO (Slightly) | | pka | 4.11±0.10(Predicted) | | form | Solid | | color | Brown to Dark Brown | | Stability: | Hygroscopic | | InChI | InChI=1S/C16H11F3N6O4/c17-16(18,19)14(29)25(9-3-1-7(2-4-9)13(27)28)6-8-5-21-11-10(22-8)12(26)24-15(20)23-11/h1-5H,6H2,(H,27,28)(H3,20,21,23,24,26) | | InChIKey | IJGIHDXKYQLIMA-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(N(CC2=CN=C3C(=N2)C(=O)NC(N)=N3)C(C(F)(F)F)=O)C=C1 |
| Hazard Codes | T | | Risk Statements | 45-20/21/22-36/37/38 | | Safety Statements | 53-22-26-36/37/39-45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | HS Code | 29339900 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral Carc. 1B Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | N10-(TRIFLUOROACETYL)PTEROIC ACID Usage And Synthesis |
| Chemical Properties | white Solid | | Uses | N10-Trifluoroacetylpteroic acid is a derivative of Pteroic acid (P840110), both of which are used as reagents to synthesize target ligands, like Folic acid (F680300), that have the ability to deliver chemotherapeutic agents specifically to cancer cells. |
| | N10-(TRIFLUOROACETYL)PTEROIC ACID Preparation Products And Raw materials |
|