|
|
| | 3,4-Difluorobenzylamine Basic information |
| Product Name: | 3,4-Difluorobenzylamine | | Synonyms: | (3,4-Difluorophenyl)methanamine;Benzenemethanamine, 3,4-difluoro-;RARECHEM AL BW 0298;3,4-DIFLUOROBENZYLAMINE;3,4-Difluorobenzylamine 99%;3,4-Difluorobenzylamine99%;3, 4-DIFLUOROBENZYLAMINE,98%;3,4-Difluorobenzenemethanamine | | CAS: | 72235-53-1 | | MF: | C7H7F2N | | MW: | 143.13 | | EINECS: | 276-503-6 | | Product Categories: | Phenyls & Phenyl-Het;Amines;C7;Nitrogen Compounds;Aminomethyl's;Phenyls & Phenyl-Het;API intermediates;Miscellaneous;Fluorobenzylamine Series;Anilines, Aromatic Amines and Nitro Compounds | | Mol File: | 72235-53-1.mol |  |
| | 3,4-Difluorobenzylamine Chemical Properties |
| Boiling point | 179°C (rough estimate) | | density | 1.21 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.493(lit.) | | Fp | 175 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 8.75±0.10(Predicted) | | form | Liquid | | color | Clear colorless to yellow | | Specific Gravity | 1.210 | | Sensitive | Air Sensitive | | BRN | 6643539 | | InChI | InChI=1S/C7H7F2N/c8-6-2-1-5(4-10)3-7(6)9/h1-3H,4,10H2 | | InChIKey | PHLZUDXEBCQHKM-UHFFFAOYSA-N | | SMILES | C1(CN)=CC=C(F)C(F)=C1 | | CAS DataBase Reference | 72235-53-1(CAS DataBase Reference) | | NIST Chemistry Reference | 3,4-Difluorobenzylamine(72235-53-1) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-27-36/37/39-45-25 | | RIDADR | UN 2735 8/PG 3 | | WGK Germany | 3 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29214990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 3,4-Difluorobenzylamine Usage And Synthesis |
| Chemical Properties | CLEAR LIGHT YELLOW LIQUID | | Uses | 3,4-Difluorobenzylamine has been used in the preparation of 2-[(5-chloro-2-methoxyphenyl)sulfonyl(2-fluoroallyl)amino]-N-(3,4-difluorobenzyl)-4-pentenamide. | | General Description | 3,4-Difluorobenzylamine on condensation with glyoxal yields corresponding hexabenzyl substituted hexaazaisowurtzitanes. |
| | 3,4-Difluorobenzylamine Preparation Products And Raw materials |
|