|
|
| | 5-CHLOROTHIOPHENE-2-CARBONYL CHLORIDE Basic information |
| Product Name: | 5-CHLOROTHIOPHENE-2-CARBONYL CHLORIDE | | Synonyms: | 5-CHLOROTHIOPHENE-2-CARBONYL CHLORIDE;5-CHOROTHIOPHENE-2-ARBONYL CHLORIDE;5-Chlorothiophene-2-carbonyl chloride ,97%;2-Thiophenecarbonyl chloride, 5-chloro- (9CI);5-Chorothiophene-2-carbonyl chloride;2-thiophenecarbonyl chloride, 5-chloro-;5-Chloro-2-thiophenecarbonyl chloride;2-Chloro-5-(chlorocarbonyl)thiophene, 2-Chloro-5-(chloroformyl)thiophene | | CAS: | 42518-98-9 | | MF: | C5H2Cl2OS | | MW: | 181.04 | | EINECS: | 800-982-8 | | Product Categories: | ACIDHALIDE | | Mol File: | 42518-98-9.mol |  |
| | 5-CHLOROTHIOPHENE-2-CARBONYL CHLORIDE Chemical Properties |
| Melting point | 4℃ | | Boiling point | 122-127℃/16Torr | | density | 1.50 | | refractive index | 1.6040 to 1.6080 | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless to Pale Yellow | | Water Solubility | Slightly soluble in water. | | Sensitive | Moisture Sensitive | | Stability: | Hygroscopic | | InChI | InChI=1S/C5H2Cl2OS/c6-4-2-1-3(9-4)5(7)8/h1-2H | | InChIKey | BMPDCQVRKDNUAP-UHFFFAOYSA-N | | SMILES | C(Cl)(C1SC(Cl)=CC=1)=O | | CAS DataBase Reference | 42518-98-9(CAS DataBase Reference) |
| Risk Statements | 36-43 | | Safety Statements | 26-36 | | RIDADR | 3265 | | HazardClass | IRRITANT | | HazardClass | 8 | | PackingGroup | Ⅲ | | HS Code | 29339900 |
| | 5-CHLOROTHIOPHENE-2-CARBONYL CHLORIDE Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liquid | | Uses | 5-Chlorothiophene-2-carbonyl chloride used as a intermediate for rivaroxaban. | | Synthesis | General procedure for the synthesis of 5-chloro-2-thiophene carbonyl chloride from 2-acetyl-5-chlorothiophene: To a mixed solution containing 2-acetyl-5-chlorothiophene (0.161 mg, 1.0 mmol), pyridine (0.012 mL, 0.15 mmol), and chlorobenzene (0.35 mL), at room temperature, disulfur dichloride (S2Cl2, 0.16 mL 2.0 mmol) with continuous stirring. After 2 hours of reaction, sulfuryl chloride (SO2Cl2, 0.121 mL, 1.5 mmol) was added dropwise and stirring was continued for 0.5 hours at room temperature. Subsequently, the reaction mixture was heated to 132 °C and stirred at this temperature for 15 hours. Upon completion of the reaction, the reaction mixture was diluted with deuterated chloroform (CDCl3, 2 mL) and an internal standard (tributyl phosphate, 1BU3PO4, 0.0552 mL, 0.20 mmol) was added for nuclear magnetic resonance (1H NMR) analysis.1H NMR analysis showed an 80% yield of 5-chloro-2-thiophene carbonyl chloride.1H NMR (PhCl. CDCl3, 400 MHz) chemical shift values: δ = 7.99 (d, J = 4 Hz, 1H), 6.86 (d, J = 4 Hz, 1H). | | References | [1] Patent: WO2017/5606, 2017, A1. Location in patent: Page/Page column 33
[2] Patent: WO2016/150937, 2016, A1. Location in patent: Page/Page column 27
[3] Recueil des Travaux Chimiques des Pays-Bas, 1950, vol. 69, p. 1083,1103
[4] Journal of Organic Chemistry, 2015, vol. 80, # 20, p. 10370 - 10374
[5] Patent: WO2016/202757, 2016, A1. Location in patent: Page/Page column 30 |
| | 5-CHLOROTHIOPHENE-2-CARBONYL CHLORIDE Preparation Products And Raw materials |
|