|
|
| | 3-METHYL-2-OXAZOLIDONE Basic information |
| | 3-METHYL-2-OXAZOLIDONE Chemical Properties |
| Melting point | 15 °C(lit.) | | Boiling point | 87-90 °C1 mm Hg(lit.) | | density | 1.17 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.454(lit.) | | Fp | >230 °F | | storage temp. | Storage temp. 2-8°C | | form | powder to lump to clear liquid | | pka | -1.34±0.20(Predicted) | | color | White or Colorless to Light yellow | | Dielectric constant | 79.299999999999997 | | InChI | InChI=1S/C4H7NO2/c1-5-2-3-7-4(5)6/h2-3H2,1H3 | | InChIKey | VWIIJDNADIEEDB-UHFFFAOYSA-N | | SMILES | O1CCN(C)C1=O | | EPA Substance Registry System | 2-Oxazolidinone, 3-methyl- (19836-78-3) |
| WGK Germany | 3 | | RTECS | RQ3550000 | | TSCA | TSCA listed | | HS Code | 2934999090 | | Storage Class | 10 - Combustible liquids |
| | 3-METHYL-2-OXAZOLIDONE Usage And Synthesis |
| Uses | 3-Methyl-2-oxazolidinone mixed with ethylene carbonate or dimethyl carbonate in the presence of lithium tetrafluoroborate or lithium hexafluorophosphate has been used as an electrolyte in lithium batteries. | | Purification Methods | Purify the oxazolidone by successive fractional freezing, then dry it in a dry-box over 4A molecular sieves for 2 days. Distil it under high vacuum and store it dry as before. [Beilstein 27 III/IV 2517.] |
| | 3-METHYL-2-OXAZOLIDONE Preparation Products And Raw materials |
|