| Company Name: |
Aikon International Limited
|
| Tel: |
025-58851090 15955137747 |
| Email: |
sales01@aikonchem.com |
| Products Intro: |
Product Name:1-(5-methyl-1H-benzimidazol-2-yl)ethanamine dihydrochloride CAS:1260807-94-0 Purity:95+% Package:1g;5g;10g
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:1-(5-Methyl-1H-benzimidazol-2-yl)ethanamine dihydrochloride
|
| Company Name: |
ChemBridge Corporation
|
| Tel: |
(858)451-7400 |
| Email: |
resupply@chembridge.com |
| Products Intro: |
Product Name:1-(5-methyl-1H-benzimidazol-2-yl)ethanamine dihydrochloride CAS:1260807-94-0 Purity:0.95 Package:50g
|
| Company Name: |
Riedel-de Haen AG
|
| Tel: |
800 558-9160 |
| Email: |
|
| Products Intro: |
Purity:AldrichCPR
|
|
| | 1-(5-Methyl-1H-benzimidazol-2-yl)ethanamine dihydrochloride Basic information |
| | 1-(5-Methyl-1H-benzimidazol-2-yl)ethanamine dihydrochloride Chemical Properties |
| form | solid | | InChI | 1S/C10H13N3.2ClH/c1-6-3-4-8-9(5-6)13-10(12-8)7(2)11;;/h3-5,7H,11H2,1-2H3,(H,12,13);2*1H | | InChIKey | SKBYHMUSHZYYDF-UHFFFAOYSA-N | | SMILES | Cl.Cl.CC(N)c1nc2cc(C)ccc2[nH]1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 1-(5-Methyl-1H-benzimidazol-2-yl)ethanamine dihydrochloride Usage And Synthesis |
| | 1-(5-Methyl-1H-benzimidazol-2-yl)ethanamine dihydrochloride Preparation Products And Raw materials |
|