|
|
| | 2,2,3,3,4,4-HEXAFLUORO-1,5-PENTANEDIOL Basic information |
| Product Name: | 2,2,3,3,4,4-HEXAFLUORO-1,5-PENTANEDIOL | | Synonyms: | 1,5-Pentanediol, 2,2,3,3,4,4-hexafluoro-;2,2,3,3,4,4-hexafluoro-5-pentanediol;2,2,3,3,4,4-Hexafluoropentan-1,5-diol;2,2,3,3,4,4-Hexafluoropentanediol;Hexafluoroamylene glycol;HEXAFLUORO-1,5-PENTANEDIOL;2,2,3,3,4,4-HEXAFLUORO-1,5-PENTANEDIOL;2,2,3,3,4,4-HEXAFLUOROPENTANE-1,5-DIOL | | CAS: | 376-90-9 | | MF: | C5H6F6O2 | | MW: | 212.09 | | EINECS: | 206-819-1 | | Product Categories: | Oxygen Compounds;Organic Building Blocks;Oxygen Compounds;Polyols;Alkyl Fluorinated Building Blocks;Other Fluorinated Organic Building Blocks;Building Blocks;Chemical Synthesis;Fluorinated Building Blocks;Organic Building Blocks;Organic Fluorinated Building Blocks | | Mol File: | 376-90-9.mol |  |
| | 2,2,3,3,4,4-HEXAFLUORO-1,5-PENTANEDIOL Chemical Properties |
| Melting point | 78-81 °C(lit.) | | Boiling point | 111.5 °C10 mm Hg(lit.) | | density | 1.4048 (estimate) | | Fp | >110°C | | form | powder to crystal | | pka | 12.68±0.10(Predicted) | | color | White to Almost white | | BRN | 1766258 | | InChI | 1S/C5H6F6O2/c6-3(7,1-12)5(10,11)4(8,9)2-13/h12-13H,1-2H2 | | InChIKey | IELVMUPSWDZWSD-UHFFFAOYSA-N | | SMILES | OCC(F)(F)C(F)(F)C(F)(F)CO | | CAS DataBase Reference | 376-90-9(CAS DataBase Reference) | | EPA Substance Registry System | 1,5-Pentanediol, 2,2,3,3,4,4-hexafluoro- (376-90-9) |
| Hazard Codes | Xn,Xi,T | | Risk Statements | 22-36/37/38 | | Safety Statements | 36-36/37-26 | | WGK Germany | 3 | | RTECS | SA0750000 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HazardClass | IRRITANT, TOXIC | | HS Code | 29055900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2,2,3,3,4,4-HEXAFLUORO-1,5-PENTANEDIOL Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | 2,2,3,3,4,4-Hexafluoro-1,5-pentanediol can be used for the preparation of cyclic and acyclic polyfluorosiloxanes as precursors to per- and polyfluoroethers. |
| | 2,2,3,3,4,4-HEXAFLUORO-1,5-PENTANEDIOL Preparation Products And Raw materials |
|