|
|
| | rel-(3r,4r)-3-(boc-amino)-5-fluoropiperidine Basic information |
| Product Name: | rel-(3r,4r)-3-(boc-amino)-5-fluoropiperidine | | Synonyms: | (3R,5R)-3-(Boc-amino)-5-fluoropiperidine;rel-(3r,4r)-3-(boc-amino)-5-fluoropiperidine;tert-Butyl ((3R,5R)-5-fluoropiperidin-3-yl)carbamate;tert-butyl N-[(3R,5R)-5-fluoropiperidin-3-yl]carbamate;(3R,4R)-Rel-3-(Boc-amino)-5-fluoropiperidine;(3R,5R)-(5-Fluoro-piperidin-3-yl)-carbamic acid tert-butyl ester;Carbamic acid, N-[(3R,5R)-5-fluoro-3-piperidinyl]-, 1,1-dimethylethyl ester | | CAS: | 1363378-07-7 | | MF: | C10H19FN2O2 | | MW: | 218.27 | | EINECS: | | | Product Categories: | | | Mol File: | 1363378-07-7.mol |  |
| | rel-(3r,4r)-3-(boc-amino)-5-fluoropiperidine Chemical Properties |
| Boiling point | 313.3±42.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 11.68±0.40(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H19FN2O2/c1-10(2,3)15-9(14)13-8-4-7(11)5-12-6-8/h7-8,12H,4-6H2,1-3H3,(H,13,14)/t7-,8-/m1/s1 | | InChIKey | ACHGEWOGBWGEEL-HTQZYQBOSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@@H]1C[C@@H](F)CNC1 |
| | rel-(3r,4r)-3-(boc-amino)-5-fluoropiperidine Usage And Synthesis |
| Uses | (3R,4R)-rel-3-(Boc-amino)-5-fluoropiperidine is a useful reagent for the preparation of FLT3 kinase inhibitor for treating FLT3 mediated diseases. |
| | rel-(3r,4r)-3-(boc-amino)-5-fluoropiperidine Preparation Products And Raw materials |
|