| Company Name: |
Shanghai Helai Biotech Co. Ltd. Gold
|
| Tel: |
15721400568 |
| Email: |
helaibiotech@163.com |
| Products Intro: |
Product Name:5-Fluoro-2-iodo-4-methyl-phenylamine
CAS:1126423-32-2
Package:5g;250g;500g
|
| Company Name: |
Shanghai Amico Chemicals Co. LTD
|
| Tel: |
微信 17321281695 18019252918 |
| Email: |
1454668768@qq.com |
| Products Intro: |
Product Name:5-Fluoro-2-iodo-4-methylaniline
CAS:1126423-32-2
Purity:0.97 Package:1g;10g;100g
|
| Company Name: |
Shanghai Yanze Chemical Co., Ltd.
|
| Tel: |
13773155751 19901447308 |
| Email: |
260924549@qq.com |
| Products Intro: |
CAS:1126423-32-2
Purity:99%HPLC Package:100kg;25kg;10kg；5kg；1kg
|
| Company Name: |
Hubei Xinyang Medical Technology Co., Ltd
|
| Tel: |
15347293736 |
| Email: |
2853117764@yongstandards.com |
| Products Intro: |
Product Name:5-Fluoro-2-iodo-4-methyl-phenylamine
CAS:1126423-32-2
Purity:99% HPLC Package:10mg；25mg；50mg；100mg
|
|
| | 5-Fluoro-2-iodo-4-methyl-phenylamine Basic information |
| | 5-Fluoro-2-iodo-4-methyl-phenylamine Chemical Properties |
| Boiling point | 264.8±40.0 °C(Predicted) | | density | 1.869±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 1.95±0.10(Predicted) | | Appearance | Light brown to brown Solid | | InChI | InChI=1S/C7H7FIN/c1-4-2-6(9)7(10)3-5(4)8/h2-3H,10H2,1H3 | | InChIKey | RXURPBBFOXPWTF-UHFFFAOYSA-N | | SMILES | C1(N)=CC(F)=C(C)C=C1I |
| | 5-Fluoro-2-iodo-4-methyl-phenylamine Usage And Synthesis |
| | 5-Fluoro-2-iodo-4-methyl-phenylamine Preparation Products And Raw materials |
|