|
|
| | 2-Hydroxy-6-methylpyridine Basic information | | Application |
| | 2-Hydroxy-6-methylpyridine Chemical Properties |
| Melting point | 157-159 °C (lit.) | | Boiling point | 131-133C | | density | 1.1143 (rough estimate) | | refractive index | 1.5040 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | 12.12±0.10(Predicted) | | form | Crystalline Powder | | color | White to cream | | BRN | 107073 | | InChI | InChI=1S/C6H7NO/c1-5-3-2-4-6(8)7-5/h2-4H,1H3,(H,7,8) | | InChIKey | JEAVIRYCMBDJIU-UHFFFAOYSA-N | | SMILES | C1(=O)NC(C)=CC=C1 | | CAS DataBase Reference | 3279-76-3(CAS DataBase Reference) | | NIST Chemistry Reference | 2(1H)-Pyridinone, 6-methyl-(3279-76-3) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-40 | | Safety Statements | 26-36-22 | | WGK Germany | 3 | | F | 10 | | HazardClass | IRRITANT | | HS Code | 29333999 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Hydroxy-6-methylpyridine Usage And Synthesis |
| Application | 2-Hydroxy-6-methylpyridine is a heterocyclic organic compound with wide applications in organic synthesis. This product is basic and can catalyze the silylation of alcohols; it can also deprotect acetals. | | Chemical Properties | white to cream-colored crystalline powder | | Uses | 2-Hydroxy-6-methylpyridine reacts with carboxylic acids RCOOH to give an equilibrium mixture of products M(2)(O(2)CR)(n)(mhp)(4-n) where R = 2-thienyl and phenyl. mhp is the anion formed from deprotonation of 2-hydroxy-6-methylpyridine. | | Synthesis Reference(s) | Journal of the American Chemical Society, 71, p. 1186, 1949 DOI: 10.1021/ja01172a014 | | General Description | 2-Hydroxy-6-methylpyridine reacts with carboxylic acids RCOOH to give an equilibrium mixture of products M(2)(O(2)CR)(n)(mhp)(4-n) where R = 2-thienyl and phenyl. mhp is the anion formed from deprotonation of 2-hydroxy-6-methylpyridine. |
| | 2-Hydroxy-6-methylpyridine Preparation Products And Raw materials |
|