| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | Melphalan Methyl Ester HCl Basic information |
| Product Name: | Melphalan Methyl Ester HCl | | Synonyms: | Melphalan Impurity 8（Melphalan EP Impurity H）;Melphalan EP Impurity H HCl (Melphalan Methyl Ester HCl);Melphalan Impurity 8;Melphalan EP Impurity H HCl;Melphalan Methyl Ester HCl;methyl 2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate;FHKHNGPONDWSEP-ZOWNYOTGSA-N;Melphalan EP lmpurity H | | CAS: | 62978-52-3 | | MF: | C14H21Cl3N2O2 | | MW: | 355.68 | | EINECS: | | | Product Categories: | | | Mol File: | 62978-52-3.mol |  |
| | Melphalan Methyl Ester HCl Chemical Properties |
| solubility | Aqueous Acid (Slightly, Heated, Sonicated), DMSO (Slightly), Methanol (Slightly) | | form | Sticky Solid to Solid | | color | Light Yellow to Dark Yellow | | Stability: | Hygroscopic | | InChI | InChI=1/C14H20Cl2N2O2.ClH/c1-20-14(19)13(17)10-11-2-4-12(5-3-11)18(8-6-15)9-7-16;/h2-5,13H,6-10,17H2,1H3;1H/t13-;/s3 | | InChIKey | FHKHNGPONDWSEP-PHCOUKOGNA-N | | SMILES | N(C1C=CC(C[C@H](N)C(=O)OC)=CC=1)(CCCl)CCCl.Cl |&1:6,r| |
| | Melphalan Methyl Ester HCl Usage And Synthesis |
| Uses | Melphalan Methyl Ester Hydrochloride is the methyl ester derivative of Melphalan (M216900); an antineoplastic. |
| | Melphalan Methyl Ester HCl Preparation Products And Raw materials |
|