|
|
| | tert-butyl 3-amino-4,6-dihydropyrrolo[3,4-c]pyrazole-5(2H)-carboxylate Basic information |
| Product Name: | tert-butyl 3-amino-4,6-dihydropyrrolo[3,4-c]pyrazole-5(2H)-carboxylate | | Synonyms: | tert-butyl 3-amino-4,6-dihydropyrrolo[3,4-c]pyrazole-5(2H)-carboxylate;tert-butyl 3-aminopyrrolo[3,4-c]pyrazole-5(2H,4H,6H)-carboxylate;Pyrrolo[3,4-c]pyrazole-5(4H)-carboxylic acid, 3-amino-2,6-dihydro-, 1,1-dimethylethyl ester | | CAS: | 1204415-47-3 | | MF: | C10H16N4O2 | | MW: | 224.26 | | EINECS: | | | Product Categories: | | | Mol File: | 1204415-47-3.mol | ![tert-butyl 3-amino-4,6-dihydropyrrolo[3,4-c]pyrazole-5(2H)-carboxylate Structure](CAS/20180703/GIF/1204415-47-3.gif) |
| | tert-butyl 3-amino-4,6-dihydropyrrolo[3,4-c]pyrazole-5(2H)-carboxylate Chemical Properties |
| Boiling point | 433.0±45.0 °C(Predicted) | | density | 1.314±0.06 g/cm3(Predicted) | | form | solid | | pka | 15.80±0.20(Predicted) | | InChI | 1S/C10H16N4O2/c1-10(2,3)16-9(15)14-4-6-7(5-14)12-13-8(6)11/h4-5H2,1-3H3,(H3,11,12,13) | | InChIKey | BEVRTOCHMXNPLY-UHFFFAOYSA-N | | SMILES | NC1=C(CN(C(OC(C)(C)C)=O)C2)C2=NN1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| | tert-butyl 3-amino-4,6-dihydropyrrolo[3,4-c]pyrazole-5(2H)-carboxylate Usage And Synthesis |
| | tert-butyl 3-amino-4,6-dihydropyrrolo[3,4-c]pyrazole-5(2H)-carboxylate Preparation Products And Raw materials |
|