|
|
| | Tetrahydromethyl-1,3-isobenzofurandione Basic information |
| Product Name: | Tetrahydromethyl-1,3-isobenzofurandione | | Synonyms: | 4-METHYL TETRAHYDROPHTHALIC ANHYDRIDE;3-METHYL-DELTA4-TETRAHYDROPHTHALIC ANHYDRIDE;3-METHYL-4-CYCLOHEXENE-1,2-DICARBOXYLIC ANHYDRIDE;3-METHYL-4-CYCLOHEXEN-1,2-DICARBOXYLIC ANHYDRIDE;AC-METHYL;1,3-Isobenzofurandione, 3a,4;4-methyl-3a,4,7,7a-tetrahydroisobenzofuran-1,3-quinone;cis,cis-3-Methyl-4-cyclohexene-1,2-dicarboxylic acid anhydride | | CAS: | 11070-44-3 | | MF: | C9H10O3 | | MW: | 166.17 | | EINECS: | 234-290-7 | | Product Categories: | | | Mol File: | 11070-44-3.mol |  |
| | Tetrahydromethyl-1,3-isobenzofurandione Chemical Properties |
| Melting point | <-100.00°C | | Boiling point | 120 °C/3 mmHg | | density | 1,21 g/cm3 | | vapor pressure | 0.373Pa at 24.85℃ | | refractive index | 1.4970 to 1.5020 | | Fp | 157 °C | | storage temp. | Storage temp. 2-8°C | | Water Solubility | Soluble in water | | form | clear liquid | | color | Colorless to Light yellow | | InChI | InChI=1S/C9H10O3/c1-5-3-2-4-6-7(5)9(11)12-8(6)10/h2-3,5-7H,4H2,1H3 | | InChIKey | XPEKVUUBSDFMDR-UHFFFAOYSA-N | | SMILES | C12C(C)C=CCC1C(OC2=O)=O | | LogP | 2.45 at 20℃ | | CAS DataBase Reference | 11070-44-3(CAS DataBase Reference) | | EPA Substance Registry System | 1,3-Isobenzofurandione, tetrahydromethyl- (11070-44-3) |
| | Tetrahydromethyl-1,3-isobenzofurandione Usage And Synthesis |
| Chemical Properties | colorless or light yellow liquid | | Uses | Methyltetrahydrophthalic Anhydride (abbreviation:MTHPA) has been used in the curing agents for epoxy resins, solvent-free paints,laminated boards, epoxy adhesives and so on. When used in the curing agent for epoxy resins, there are many excellent performances such as the long-term storage at room temperature, low freezing point, low volatility and low toxicity. Also widely used in motors, dry-type transformers, appliances capacitors, power capacitors, integrated circuits impregnation, casting and winding. | | Uses | Methyltetrahydrophthalic Anhydride (MTHPA) is used in preparation method of conductive adhesive. | | Flammability and Explosibility | Non flammable |
| | Tetrahydromethyl-1,3-isobenzofurandione Preparation Products And Raw materials |
|