|
|
| | 3-Indoxyl-beta-D-glucuronic acid cyclohexylammonium salt Basic information |
| | 3-Indoxyl-beta-D-glucuronic acid cyclohexylammonium salt Chemical Properties |
| Boiling point | 669.0±55.0 °C(Predicted) | | density | 1.693±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | pka | 2.82±0.70(Predicted) | | form | powder | | Optical Rotation | [α]20/D -80.0±5.0 | | InChI | 1S/C14H15NO7/c16-9-10(17)12(13(19)20)22-14(11(9)18)21-8-5-15-7-4-2-1-3-6(7)8/h1-5,9-12,14-18H,(H,19,20) | | InChIKey | KUYNOZVWCFXSNE-UHFFFAOYSA-N | | SMILES | OC1C(OC(C(O)C1O)C(O)=O)Oc2c[nH]c3ccccc23 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-36-26 | | WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | 3-Indoxyl-beta-D-glucuronic acid cyclohexylammonium salt Usage And Synthesis |
| Chemical Properties | White or off-white powder | | Uses | 3-Indolyl-β-D-glucuronide, a chromogenic substrate for β-D-glucuronidase, employs in the detection and enumeration of E. coli, yielding a blue precipitate upon cleavage. 3-Indolyl-β-D-glucuronide in patients' plasma act as a new indicator of renal failure[1][2]. | | Definition | ChEBI: Inodxyl glucuronide is a glucosiduronic acid. | | References | [1] S Fujita, et al. [Evaluation of a new disk containing indoxyl-beta-D-glucuronide for rapid identification of Escherichia coli]. Rinsho Byori. 1996 Sep;44(9):895-8. PMID:8911077 [2] S Agatsuma, et al. Indoxyl-beta-D-glucuronide and 3-indoxyl sulfate in plasma of hemodialysis patients. Clin Nephrol. 1996 Apr;45(4):250-6. PMID:8861801 |
| | 3-Indoxyl-beta-D-glucuronic acid cyclohexylammonium salt Preparation Products And Raw materials |
|