|
|
| | 1,2-Di(4-carboxyphenyl)-1,2-diphenylethylene Basic information |
| Product Name: | 1,2-Di(4-carboxyphenyl)-1,2-diphenylethylene | | Synonyms: | 1,2-Di(4-carboxyphenyl)-1,2-diphenylethylene;4,4'-(1,2-Diphenyl-1,2-ethenediyl)bis[benzoic acid;4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzoic acid;1,2-Di(4-carboxyphenyl)-1,2,2-triphenylethene;4,4'-(1,2-Diphenylvinyl)-1,2-di-(phenylcarboxylic acid);Benzoic acid, 4,4'-(1,2-diphenyl-1,2-ethenediyl)bis-;TPE26;2-Di(4-carboxyphenyl)-1 | | CAS: | 1002339-79-8 | | MF: | C28H20O4 | | MW: | 420.46 | | EINECS: | | | Product Categories: | | | Mol File: | 1002339-79-8.mol |  |
| | 1,2-Di(4-carboxyphenyl)-1,2-diphenylethylene Chemical Properties |
| Boiling point | 587.1±50.0 °C(Predicted) | | density | 1.271±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 3.82±0.10(Predicted) | | form | solid | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C28H20O4/c29-27(30)23-15-11-21(12-16-23)25(19-7-3-1-4-8-19)26(20-9-5-2-6-10-20)22-13-17-24(18-14-22)28(31)32/h1-18H,(H,29,30)(H,31,32) | | InChIKey | MTTUYJXPONEHGK-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(C=C1)C(O)=O)(C1=CC=CC=C1)=C(C1=CC=C(C=C1)C(O)=O)C1=CC=CC=C1 |
| | 1,2-Di(4-carboxyphenyl)-1,2-diphenylethylene Usage And Synthesis |
| Uses | TPE-CA is an aggregation-induced emission (AIE) dye for esterification with hydroxyl and amino groups. |
| | 1,2-Di(4-carboxyphenyl)-1,2-diphenylethylene Preparation Products And Raw materials |
|