| Company Name: |
D&C Chemicals |
| Tel: |
+86-21-58447131 |
| Email: |
1724405207@qq.com |
|
| | Cyclic Arg-Gly-Asp-D-Tyr-Lys Basic information |
| Product Name: | Cyclic Arg-Gly-Asp-D-Tyr-Lys | | Synonyms: | Cyclic Arg-Gly-Asp-D-Tyr-Lys;Cyclo(RGDyK) trifluoroacetate;CCyclic Arg-Gly-Asp-D-Tyr-Lys;Cyclo(L-arginylglycyl-L-α-aspartyl-D-tyrosyl-L-lysyl) di2,2,2-Trifluoroacetic acid salt;Cyclo(RGDyK) TFA;Integrin,Cyclo(RGDyK) trifluoroacetate,inhibit,Inhibitor;2,2,2-Trifluoroacetic acid compound with 2-((2S,5R,8S,11S)-8-(4-aminobutyl)-11-(3-guanidinopropyl)-5-(4-hydroxybenzyl)-3,6,9,12,15-pentaoxo-1,4,7,10,13-pentaazacyclopentadecan-2-yl)acetic acid (2:1);Cyclo(RGDyK) trifluoroacetate, 10 mM in DMSO | | CAS: | 250612-42-1 | | MF: | C29H42F3N9O10 | | MW: | 733.7 | | EINECS: | | | Product Categories: | | | Mol File: | 250612-42-1.mol |  |
| | Cyclic Arg-Gly-Asp-D-Tyr-Lys Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Soluble in DMSO | | form | Solid | | color | White to off-white | | Sequence | cyclo(Arg-Gly-Asp-{d-Tyr}-Lys) | | InChIKey | KTQFOJMRRQLTAN-CNDMKARKNA-N | | SMILES | C(F)(F)(F)C(=O)O.C(C1C=CC(O)=CC=1)[C@H]1NC([C@@H](NC(CNC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCCN)NC1=O)=O)CC(=O)O)=O |&1:15,18,25,36,r| |
| | Cyclic Arg-Gly-Asp-D-Tyr-Lys Usage And Synthesis |
| Uses | Cyclo(RGDyK) trifluoroacetate is a potent and selective αVβ3 integrin inhibitor with an IC50 of 20 nM. | | Biological Activity | Cyclo(RGDyK) is a potent and selective αVβ3 integrin inhibitor with IC50 of 20 nM. | | in vitro | Cyclo(RGDyK) showed higher affinity and selectivity for αVβ3 than αVβ5 and αIIbβ3. Cyclo(RGDyK)-bound micelles (TPM) promoted cell-specific uptake of DiI by B16-F10 cells and HUVECs through integrin-mediated endocytosis compared to Cyclo(RGDyK)-free micelles (NPM). | | in vivo | Cyclo(RGDyK) (1 nmol, iv) inhibits the increase in αVβ3 integrin expression in the intima of left stenotic carotid arteries in apoE/ mice. | | target | | Target | Value | | αVβ3 integrin | 20 nM |
| | IC 50 | αvβ3: 20 nM (IC50) | | References | [1] Haubner R, et al. Glycosylated RGD-containing peptides: tracer for tumor targeting and angiogenesis imaging with improved biokinetics. J Nucl Med. 2001 Feb;42(2):326-36. PMID:11216533 |
| | Cyclic Arg-Gly-Asp-D-Tyr-Lys Preparation Products And Raw materials |
|