- XPhos Pd G4
-
- $0.00 / 1KG
-
2026-01-30
- CAS:1599466-81-5
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 30tons/month
|
| | XPhos Pd G4 Basic information |
| Product Name: | XPhos Pd G4 | | Synonyms: | (SP-4-3)-[Dicyclohexyl[2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine](methanesulfonato)[2'-(methylamino)[1,1'-biphenyl]-2-yl]palladium;Methanesulfonato(2-dicyclohexylphosphino-2',4',6'-tri-i-propyl-1,1'-biphenyl)(2'-methylamino-1,1'-biphenyl-2-yl)palladium(II);Methanesulfonato(2-dicyclohexylphosphino-2',4',6'-tri-i-propyl-1,1'-biphenyl)(2'-methylamino-1,1'-biphenyl-2-yl)palladium(II),[XPhos Palladacycle Gen. 4];Xphos Palladacycle Gen.4;METHANESULFONATO(2-DICYCLOHEXYLPHOSPHINO-2',4',6'-TRI-I-PROPYL-1,1'-BIPHENYL)(2'-METHYLAMINO-1,1'-BIPHENYL-2-YL)PALLADIUM(II),MIN.98%[XPHOSPALLADACYCLEGEN.4];(2dicyclohexylphosphino2′,4′,6′triisopropyl1,1′biphenyl)[2(2′methylamino1,1′biphenyl)]palladium(II) methanesulfonate;Methanesulfonato(2-dicyclohexylphosphino-2',4',6'-tri-i-propyl-1,1'-biphenyl)(2'-methylamino-1,1'-biphenyl-2-yl)palladium(II) /
XPhos Pd G4;Methanesulfonato(2-dicyclohexylphosphino-2',4',6'-... | | CAS: | 1599466-81-5 | | MF: | C47H64NO3PPdS | | MW: | 860.49 | | EINECS: | | | Product Categories: | Buchwald Ligands&Precatalysts;Buchwald Precatalysts Series;Pd | | Mol File: | 1599466-81-5.mol |  |
| | XPhos Pd G4 Chemical Properties |
| Melting point | 150 °C | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | form | Powder | | color | white to off-white | | InChIKey | RWNNUNWRORBXQJ-UHFFFAOYSA-N | | SMILES | P(C1CCCCC1)(C1CCCCC1)(C1C=CC=CC=1C1C(=CC(C(C)C)=CC=1C(C)C)C(C)C)[Pd+2]1(N(C2=CC=CC=C2C2=CC=CC=[C-]12)C)[O-]S(=O)(=O)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | XPhos Pd G4 Usage And Synthesis |
| Chemical Properties | Powder. Bench stable, soluble in most organic solvents. | | Uses | XPhos Pd G4 is a powerful ligand for classic cross-coupling reactions combined with the Buchwald Fourth Generation Palladacycle. | | Reactions | Palladium catalyst used in the Suzuki-Miyaura coupling of unstable boronic acids.
 | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Cross Couplings
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst | | Synthesis | A dry round-bottomed flask (25 mL) was equipped with a stirring bar and then palladium dimer methanesulfonate (1 mmol) and XPhos (0.953 g) were added to the reaction flask under nitrogen atmosphere. Dry dichloromethane was added to the above reaction mixture as reaction solvent (10 mL) and the mixture was stirred at room temperature for 16 hours. At the end of the reaction the resulting reaction mixture was concentrated under vacuum making the total volume of the mixture about 1-2 mL. To the above reaction mixture n-pentane (20 mL) was added to precipitate a black solid and the mixture was filtered. The resulting filtrate was concentrated in vacuo to afford XPhos Pd G4, (SP-4-3)-[dicyclohexyl[2',4',6'-tris(isopropyl)[1,1'-biphenyl]-2-yl]phosphine](methanesulfonic acid)[2'-(methylamino)[1,1'-biphenyl]-2-yl]palladium. |
| | XPhos Pd G4 Preparation Products And Raw materials |
|