|
|
| | 2,2-DIMETHYL-N-PYRIDIN-2-YL-PROPIONAMIDE Basic information |
| | 2,2-DIMETHYL-N-PYRIDIN-2-YL-PROPIONAMIDE Chemical Properties |
| Melting point | 71-75 °C(lit.) | | Boiling point | 349.3±15.0 °C(Predicted) | | density | 1.078±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Dichloromethane, Ethyl Acetate, Methanol | | pka | 13.82±0.70(Predicted) | | form | Solid | | color | White | | InChI | InChI=1S/C10H14N2O/c1-10(2,3)9(13)12-8-6-4-5-7-11-8/h4-7H,1-3H3,(H,11,12,13) | | InChIKey | CGSPVYCZBDFPHJ-UHFFFAOYSA-N | | SMILES | C(NC1=NC=CC=C1)(=O)C(C)(C)C | | CAS DataBase Reference | 86847-59-8(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933399990 |
| | 2,2-DIMETHYL-N-PYRIDIN-2-YL-PROPIONAMIDE Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 2-Pivalamidopyridine (cas# 86847-59-8) is a compound useful in organic synthesis. |
| | 2,2-DIMETHYL-N-PYRIDIN-2-YL-PROPIONAMIDE Preparation Products And Raw materials |
|