| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | [1,1':3',1''-terphenyl]-5'-amine Basic information |
| Product Name: | [1,1':3',1''-terphenyl]-5'-amine | | Synonyms: | [1,1':3',1''-terphenyl]-5'-amine;[1,1\',3\',1\'\']terphenyl-5\'-ylamine;3,5-diphenylaniline;3,5-Diphenylaniline [1,1':3',1']terphenyl-5'-ylamine;1,1':3',1''tetrphenyl-5'-amine;1,1':3',1''-Terphenyl]-5'-amine;3,5-Diphenyl-1-phenylamine;3,5-diphenylbenzeneamine | | CAS: | 63006-66-6 | | MF: | C18H15N | | MW: | 245.32 | | EINECS: | | | Product Categories: | | | Mol File: | 63006-66-6.mol | ![[1,1':3',1''-terphenyl]-5'-amine Structure](CAS/20180703/GIF/63006-66-6.gif) |
| | [1,1':3',1''-terphenyl]-5'-amine Chemical Properties |
| Melting point | 109-110 °C(Solv: ethanol (64-17-5)) | | Boiling point | 453.9±34.0 °C(Predicted) | | density | 1.103±0.06 g/cm3(Predicted) | | pka | 4.08±0.10(Predicted) | | InChI | InChI=1S/C18H15N/c19-18-12-16(14-7-3-1-4-8-14)11-17(13-18)15-9-5-2-6-10-15/h1-13H,19H2 | | InChIKey | PWRKEYBSOWAIMY-UHFFFAOYSA-N | | SMILES | C1(C2=CC(N)=CC(C3=CC=CC=C3)=C2)=CC=CC=C1 |
| | [1,1':3',1''-terphenyl]-5'-amine Usage And Synthesis |
| | [1,1':3',1''-terphenyl]-5'-amine Preparation Products And Raw materials |
|