|
|
| | L-Valine methyl ester hydrochloride Basic information |
| | L-Valine methyl ester hydrochloride Chemical Properties |
| Melting point | 171-173 °C(lit.) | | alpha | 15.5 º (C=2,H2O 24 ºC) | | refractive index | 15.5 ° (C=2, H2O) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Crystalline Powder | | color | White | | Optical Rotation | [α]/D +15°, c = 2 in H2O | | BRN | 3594960 | | Stability: | Stable. Incompatible with strong oxidizing agents. | | InChI | InChI=1/C6H13NO2.ClH/c1-4(2)5(7)6(8)9-3;/h4-5H,7H2,1-3H3;1H/t5-;/s3 | | InChIKey | KUGLDBMQKZTXPW-NUBCRITNSA-N | | SMILES | [C@H](N)(C(C)C)C(=O)OC.Cl |&1:0,r| | | CAS DataBase Reference | 6306-52-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-36-26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29224995 |
| | L-Valine methyl ester hydrochloride Usage And Synthesis |
| Chemical Properties | Crystalline | | Uses | L-Valine Methyl Ester Hydrochloride is used in the synthesis of Valaciclovir (V085000), the L-Valine ester prodrug of Acyclovir (A192400), orally active acyclic nucleoside with inhibitory activity towards several herpes viruses. Antiviral. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | L-Valine methyl ester hydrochloride Preparation Products And Raw materials |
|