|
|
| | 2-Propenoic acid, 2-methyl-, 1-(1-methylethyl)cyclopentyl ester Basic information |
| | 2-Propenoic acid, 2-methyl-, 1-(1-methylethyl)cyclopentyl ester Chemical Properties |
| Boiling point | 239.9±9.0 °C(Predicted) | | density | 0.94±0.1 g/cm3(Predicted) | | color | Colorless to Light yellow clear liquid | | InChI | InChI=1S/C12H20O2/c1-9(2)11(13)14-12(10(3)4)7-5-6-8-12/h10H,1,5-8H2,2-4H3 | | InChIKey | GPXHHBYETPIZOU-UHFFFAOYSA-N | | SMILES | C(OC1(C(C)C)CCCC1)(=O)C(C)=C |
| | 2-Propenoic acid, 2-methyl-, 1-(1-methylethyl)cyclopentyl ester Usage And Synthesis |
| Description | 2-Propenoic acid, 2-methyl-, 1-(1-methylethyl)cyclopentyl ester, also known as 1-isopropylcyclopentyl methacrylate (IPCPMA), is an organic ester compound used in the preparation of resist materials. | | Uses | 2-Propenoic acid, 2-methyl-, 1-(1-methylethyl)cyclopentyl ester is used as a photoresist material. |
| | 2-Propenoic acid, 2-methyl-, 1-(1-methylethyl)cyclopentyl ester Preparation Products And Raw materials |
|