2-Propenoic acid, 2-methyl-, hexahydro-5-oxo-2,6-methanofuro[3,2-b]furan-3-yl ester manufacturers
|
| | 2-Propenoic acid, 2-methyl-, hexahydro-5-oxo-2,6-methanofuro[3,2-b]furan-3-yl ester Basic information |
| Product Name: | 2-Propenoic acid, 2-methyl-, hexahydro-5-oxo-2,6-methanofuro[3,2-b]furan-3-yl ester | | Synonyms: | 2-Propenoic acid, 2-methyl-, hexahydro-5-oxo-2,6-methanofuro[3,2-b]furan-3-yl ester;2-Propenoic acid, 2-methyl-, hexahydro-5-oxo-2,6-methanofuro[3,2;5-oxohexahydro-2,6-methanofuro[3,2-b]furan-3-yl?methacrylate;2-Propenoic acid, 2-methyl-,hexahydro-5-0xo-2,6-methanofuro[3,2.b]furan-3-yl ester;MNBLX | | CAS: | 274248-05-4 | | MF: | C11H12O5 | | MW: | 224.21 | | EINECS: | | | Product Categories: | | | Mol File: | 274248-05-4.mol | ![2-Propenoic acid, 2-methyl-, hexahydro-5-oxo-2,6-methanofuro[3,2-b]furan-3-yl ester Structure](CAS/20180601/GIF/274248-05-4.gif) |
| | 2-Propenoic acid, 2-methyl-, hexahydro-5-oxo-2,6-methanofuro[3,2-b]furan-3-yl ester Chemical Properties |
| Boiling point | 390.9±42.0 °C(Predicted) | | density | 1.35±0.1 g/cm3(Predicted) | | InChI | InChI=1S/C11H12O5/c1-4(2)10(12)15-8-6-3-5-7(14-6)9(8)16-11(5)13/h5-9H,1,3H2,2H3 | | InChIKey | WVDIVWQGCHTELG-UHFFFAOYSA-N | | SMILES | C(OC1C2CC3C(C1OC3=O)O2)(=O)C(C)=C |
| | 2-Propenoic acid, 2-methyl-, hexahydro-5-oxo-2,6-methanofuro[3,2-b]furan-3-yl ester Usage And Synthesis |
| Uses |
2-Propenoic acid, 2-methyl-, hexahydro-5-oxo-2,6-methanofuro[3,2-b]furan-3-yl ester can be used as a photoresist monomer.
|
| | 2-Propenoic acid, 2-methyl-, hexahydro-5-oxo-2,6-methanofuro[3,2-b]furan-3-yl ester Preparation Products And Raw materials |
|