|
|
| | Palladium(II)-ammonium chloride Basic information |
| | Palladium(II)-ammonium chloride Chemical Properties |
| Melting point | °Cd ec.) | | density | 2.17 g/mL at 25 °C(lit.) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | soluble in H2O | | form | Powder | | Specific Gravity | 2.17 | | color | Dark green to brown | | Water Solubility | Soluble in water. Insoluble in ethanol. | | Sensitive | Hygroscopic | | InChI | 1S/4ClH.2H3N.Pd/h4*1H;2*1H3;/q;;;;;;+2/p-2 | | InChIKey | IRKVTUVFHGUMMN-UHFFFAOYSA-L | | SMILES | [H][N+]([H])([H])[H].[H][N+]([H])([H])[H].Cl[Pd--](Cl)(Cl)Cl | | CAS DataBase Reference | 13820-40-1(CAS DataBase Reference) | | EPA Substance Registry System | Palladate(2-), tetrachloro-, diammonium, (SP-4-1)- (13820-40-1) |
| Hazard Codes | Xi | | Risk Statements | 20/21/22-36/37/38-36/38 | | Safety Statements | 26-27-28-36/39-37/39 | | RIDADR | UN 3288 | | WGK Germany | 3 | | RTECS | BP5400000 | | TSCA | TSCA listed | | HS Code | 28429080 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 | | Toxicity | skn-rbt 100 mg/24H SEV AEHLAU 30,168,75 |
| | Palladium(II)-ammonium chloride Usage And Synthesis |
| Chemical Properties | Olive Green Crystalline Powder | | Uses | Ammonium tetrachloropalladate(II) is one of the preferred complexes, which are used for the preparation of palladium metallic particles. In addition, it forms Pd-creatinine complexes, which find use in the field of catalysis, and semiconductors. Colloidal palladium nanocatalysts and metal polymer catalyst systems can be prepared from ammonium tetrachloropalladate. | | Definition | ChEBI: Ammonium tetrachloropalladate is a salt comprising separate ammonium cations and square planar [PdCl4](2-) anions. It contains a tetrachloropalladate(2-). | | Safety Profile | A severe skin irritant. When heated to decomposition it emitsvery toxic fumes of Cl-, NOx, and NH3. |
| | Palladium(II)-ammonium chloride Preparation Products And Raw materials |
|