| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Benzoic acid-13C7
CAS:222412-89-7
Purity:99 atom % 13C Package:100MG Remarks:586234-100MG
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:Benzoic acid-13C7 99 atom % 13C
CAS:222412-89-7
Purity:NULL Package:100mg Remarks:NULL
|
|
| | BENZOIC ACID-13C7 Basic information |
| | BENZOIC ACID-13C7 Chemical Properties |
| Melting point | 121-125 °C (lit.) | | Boiling point | 249 °C (lit.) | | Fp | 121 °C | | InChI | 1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)/i1+1,2+1,3+1,4+1,5+1,6+1,7+1 | | InChIKey | WPYMKLBDIGXBTP-BNUYUSEDSA-N | | SMILES | O[13C](=O)[13c]1[13cH][13cH][13cH][13cH][13cH]1 |
| Hazard Codes | Xn | | Risk Statements | 22-37/38-41-42/43 | | Safety Statements | 22-26-36/37/39-45 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 1 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Eye Dam. 1
Skin Irrit. 2
STOT RE 1 Inhalation |
| | BENZOIC ACID-13C7 Usage And Synthesis |
| | BENZOIC ACID-13C7 Preparation Products And Raw materials |
|