|
|
| | FHPI HCL Basic information |
| Product Name: | FHPI HCL | | Synonyms: | SB202190 HCL;SB 202190, HYDROCHLORIDE;FHPI HCL;4-[4-(4-fluorophenyl)-5-(4-pyridinyl)-1H-iMidazol-2-yl]phenol Monohydrochloride;4-(4-Fluorophenyl)-2-(4-hydroxyphenyl)-5-(4-pyridyl)-1H-imidazole monohydrochloride hydrate;4-[4-(4-Fluorophenyl)-5-(4-pyridinyl)-1H-imidazol-2-yl]phenol monohydrochloride hydrate;SB 202190 monohydrochloride hydrate;4-(4-FLUOROPHENYL)-2-(4-HYDROXYPHENYL)-5-(4-PYRIDYL)-1H-IMIDAZOLE HCL | | CAS: | 350228-36-3 | | MF: | C20H15ClFN3O | | MW: | 367.8 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | FHPI HCL Chemical Properties |
| storage temp. | -20°C | | solubility | DMSO: ≥12mg/mL | | form | solid | | color | white to beige | | Water Solubility | water: 0.5mg/mL (slightly soluble)
DMSO: soluble | | InChI | 1S/C20H14FN3O.ClH.H2O/c21-16-5-1-13(2-6-16)18-19(14-9-11-22-12-10-14)24-20(23-18)15-3-7-17(25)8-4-15;;/h1-12,25H,(H,23,24);1H;1H2 | | InChIKey | CZZOICWZVYZUNP-UHFFFAOYSA-N | | SMILES | O.Cl.Oc1ccc(cc1)-c2nc(-c3ccc(F)cc3)c([nH]2)-c4ccncc4 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | FHPI HCL Usage And Synthesis |
| Uses | The water soluble form of SB 202190, a highly selective, potent inhibitor of p38 MAP kinase. SB-202190 is able to promote proliferation of C6 cells in lower concentration but induced apoptosis in higher levels. Studies show that SB202190 can protect neural function from ischemia/reperfusion injury and regulate the activation of Bcl-2 and Bax protein after ischemia/reperfusion in rat. | | General Description | A water-soluble form of the potent p38 MAP kinase inhibitor SB 202190 (Cat. No. 559388). | | Biochem/physiol Actions | SB 202190 monohydrochloride hydrate mediates the phosphorylation of serine in the mutant p53 protein and modulates cell adhesion and prevents cell proliferation in breast cancer cell lines. |
| | FHPI HCL Preparation Products And Raw materials |
|