|
|
| | 3-Bromo-2-chlorothiophene Basic information |
| | 3-Bromo-2-chlorothiophene Chemical Properties |
| Boiling point | 70 °C9 mm Hg(lit.) | | density | 1.808 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.6(lit.) | | Fp | 215 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Yellow to Orange | | Specific Gravity | 1.827 | | Water Solubility | < 0.2 g/l (20 ºC) | | BRN | 1205539 | | InChI | InChI=1S/C4H2BrClS/c5-3-1-2-7-4(3)6/h1-2H | | InChIKey | KSHOQKKCPJELBV-UHFFFAOYSA-N | | SMILES | C1(Cl)SC=CC=1Br | | CAS DataBase Reference | 40032-73-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | RIDADR | 2810 | | WGK Germany | 3 | | HazardClass | 6.1 | | HazardClass | IRRITANT | | PackingGroup | II | | HS Code | 29349990 |
| | 3-Bromo-2-chlorothiophene Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS TO YELLOWISH LIQUID | | Uses | 3-Bromo-2-chlorothiophene is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff fields. | | References | [1] Patent: US5276025, 1994, A |
| | 3-Bromo-2-chlorothiophene Preparation Products And Raw materials |
|