|
|
| | 4-Chloro-2-fluorotoluene Basic information |
| | 4-Chloro-2-fluorotoluene Chemical Properties |
| Boiling point | 158 °C/743 mmHg (lit.) | | density | 1.186 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.498(lit.) | | Fp | 124 °F | | storage temp. | Flammables area | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | Specific Gravity | 1.186 | | Water Solubility | INSOLUBLE | | BRN | 1931682 | | InChI | InChI=1S/C7H6ClF/c1-5-2-3-6(8)4-7(5)9/h2-4H,1H3 | | InChIKey | MKFCYQTVSDCXAQ-UHFFFAOYSA-N | | SMILES | C1(C)=CC=C(Cl)C=C1F | | CAS DataBase Reference | 452-75-5(CAS DataBase Reference) |
| Hazard Codes | Xi,F | | Risk Statements | 10-36/37/38 | | Safety Statements | 16-26-36/37/39-37/39-36 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant/Flammable | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29039990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 3
Skin Irrit. 2
STOT SE 3 |
| | 4-Chloro-2-fluorotoluene Usage And Synthesis |
| Chemical Properties | colorless to light yellow liquid | | Uses | 4-Chloro-2-fluorotoluene has been used in the preparation of 4-chloro-2-fluoro-benzylbromide. | | General Description | Fourier Transform (FT)-IR and FT-Raman spectra of solid sample of 4-chloro-2-fluorotoluene have been studied. |
| | 4-Chloro-2-fluorotoluene Preparation Products And Raw materials |
|