|
|
| | SULFOSUCCINIC ACID Basic information |
| Product Name: | SULFOSUCCINIC ACID | | Synonyms: | sulfo-Butanedioicacid;sulfosuccinic;SULFOSUCCINIC ACID;sulphosuccinic acid;SULFOSUCCINIC ACID, 70 WT. % SOLUTION IN WATER;SULFOSUCCINIC ACID SOLUTION, ~70% IN WAT ER;Butanedioic acid, sulfo-;2-sulfobutanedioic acid | | CAS: | 5138-18-1 | | MF: | C4H6O7S | | MW: | 198.15 | | EINECS: | 225-898-3 | | Product Categories: | | | Mol File: | 5138-18-1.mol |  |
| | SULFOSUCCINIC ACID Chemical Properties |
| Boiling point | 140°C/1013hPa | | density | 1.438 g/mL at 25 °C | | vapor pressure | 0-0Pa at 25℃ | | refractive index | n20/D 1.449 | | storage temp. | Store below +30°C. | | pka | -0.46±0.50(Predicted) | | form | viscous liquid | | PH | 1 (20°C in H2O, saturated aqueous solution) | | BRN | 1727687 | | Stability: | Stable. Hygroscopic. Incompatible with strong oxidizing agents. | | InChI | 1S/C4H6O7S/c5-3(6)1-2(4(7)8)12(9,10)11/h2H,1H2,(H,5,6)(H,7,8)(H,9,10,11) | | InChIKey | ULUAUXLGCMPNKK-UHFFFAOYSA-N | | SMILES | OC(=O)CC(C(O)=O)S(O)(=O)=O | | LogP | -0.463 at 25℃ and pH7 | | EPA Substance Registry System | Sulfosuccinic acid (5138-18-1) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | - | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | SULFOSUCCINIC ACID Usage And Synthesis |
| Chemical Properties | viscous colourless liquid (generally supplied | | Uses | Sulfosuccinic Acid is cosmetic compound. | | Definition | ChEBI: Sulfobutanedioic acid is a thia fatty acid. |
| | SULFOSUCCINIC ACID Preparation Products And Raw materials |
|