|
|
| | 1-Propanol,2-methyl-2-[(phenylmethylene)amino]- Basic information |
| Product Name: | 1-Propanol,2-methyl-2-[(phenylmethylene)amino]- | | Synonyms: | 1-Propanol,2-methyl-2-[(phenylmethylene)amino]-;2- (BENZYLIDENEAMINO) -2-METHYLPROPAN-1-OL;2-(benzylideneamino)-2-methylpropan-1-ol; 2-(BENZYLIDENEAMINO)-2-METHYLPROPAN-1-O;2-methyl-2-{[(E)-phenylmethylidene]amino}propan-1-ol;API 2-(benzylideneamino)-2-methylpropan-1-ol powder;2-(benzylideneamino)-2-methylpropan-1-ol BMK Powder;2-Benzylideneamino-2-methylpropanol | | CAS: | 22563-90-2 | | MF: | C11H15NO | | MW: | 177.24 | | EINECS: | 202-303-5 | | Product Categories: | pharmaceutical | | Mol File: | 22563-90-2.mol | ![1-Propanol,2-methyl-2-[(phenylmethylene)amino]- Structure](CAS/20180601/GIF/22563-90-2.gif) |
| | 1-Propanol,2-methyl-2-[(phenylmethylene)amino]- Chemical Properties |
| Melting point | 65 °C | | Boiling point | 283.8±23.0 °C(Predicted) | | density | 0.94±0.1 g/cm3(Predicted) | | pka | 15.68±0.10(Predicted) | | InChI | InChI=1S/C11H15NO/c1-11(2,9-13)12-8-10-6-4-3-5-7-10/h3-8,13H,9H2,1-2H3 | | InChIKey | KPPMOMWHTWEWSI-UHFFFAOYSA-N | | SMILES | C(O)C(C)(N=CC1=CC=CC=C1)C |
| | 1-Propanol,2-methyl-2-[(phenylmethylene)amino]- Usage And Synthesis |
| Uses | 1-Propanol,2-methyl-2-[(phenylmethylene)amino]- is an important alcohol compound that can be used as an organic synthesis intermediate or chemical reaction reagent. |
| | 1-Propanol,2-methyl-2-[(phenylmethylene)amino]- Preparation Products And Raw materials |
|