|
|
| | 5-AMINO-1,3-DIPHENYLPYRAZOLE Basic information |
| Product Name: | 5-AMINO-1,3-DIPHENYLPYRAZOLE | | Synonyms: | 1,3-diphenyl-1h-pyrazol-5-amin;5-amino-1,3-diphenyl-pyrazol;BUTTPARK 48\12-72;5-AMINO-1,3-DIPHENYLPYRAZOLE;1,3-DIPHENYL-1H-PYRAZOL-5-YLAMINE;1,3-DIPHENYL-1H-PYRAZOL-5-AMINE;2,5-DIPHENYL-2H-PYRAZOL-3-YLAMINE;SALOR-INT L317934-1EA | | CAS: | 5356-71-8 | | MF: | C15H13N3 | | MW: | 235.28 | | EINECS: | | | Product Categories: | | | Mol File: | 5356-71-8.mol |  |
| | 5-AMINO-1,3-DIPHENYLPYRAZOLE Chemical Properties |
| Melting point | 128-132 °C | | Boiling point | 454.0±33.0 °C(Predicted) | | density | 1.17±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 2.77±0.10(Predicted) | | color | Light Beige | | λmax | 258nm(EtOH)(lit.) | | InChI | 1S/C15H13N3/c16-15-11-14(12-7-3-1-4-8-12)17-18(15)13-9-5-2-6-10-13/h1-11H,16H2 | | InChIKey | SXOFMEWDEKEVJU-UHFFFAOYSA-N | | SMILES | Nc1cc(nn1-c2ccccc2)-c3ccccc3 | | CAS DataBase Reference | 5356-71-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | RTECS | UQ5580000 | | HazardClass | IRRITANT | | HS Code | 2933199090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | 5-AMINO-1,3-DIPHENYLPYRAZOLE Usage And Synthesis |
| Uses | 5-Amino-1,3-diphenyl-1H-pyrazole is a reagent for the preparation of molecular switches within GIRK activator scaffold that afford selective GIRK inhibitors. |
| | 5-AMINO-1,3-DIPHENYLPYRAZOLE Preparation Products And Raw materials |
|