| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
GSK-626616 manufacturers
- GSK-626616
-
- $44.00
-
2026-07-14
- CAS:1025821-33-3
- Purity: 99.48%
- Supply Ability: 10g
|
| | GSK-626616 Basic information |
| Product Name: | GSK-626616 | | Synonyms: | (5Z)-2-[(2,6-Dichlorophenyl)amino]-5-(6-quinoxalinylmethylene)-4(5H)-thiazolone;GSK-626616;4(5H)-Thiazolone, 2-[(2,6-dichlorophenyl)amino]-5-(6-quinoxalinylmethylene)-, (5Z)-;GSK 626616,DYRK,Inhibitor,Dual specificity tyrosine regulated kinase,GSK-626616,GSK626616,inhibit,Dual specificity tyrosine phosphorylation regulated kinase;(Z)-2-((2,6-Dichlorophenyl)amino)-5-(quinoxalin-6-ylmethylene)thiazol-4(5H)-one;GSK-626616, 10 mM in DMSO;GSK 626616 - Bio-X ? | | CAS: | 1025821-33-3 | | MF: | C18H10Cl2N4OS | | MW: | 401.27 | | EINECS: | | | Product Categories: | | | Mol File: | 1025821-33-3.mol |  |
| | GSK-626616 Chemical Properties |
| Melting point | 281 - 282oC | | Boiling point | 574.8±60.0 °C(Predicted) | | density | 1.55±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Chloroform (Slightly, Heated), Methanol (Slightly) | | pka | -0.94±0.20(Predicted) | | form | Solid | | color | Pale Yellow to Light Yellow | | InChI | 1S/C18H10Cl2N4OS/c19-11-2-1-3-12(20)16(11)23-18-24-17(25)15(26-18)9-10-4-5-13-14(8-10)22-7-6-21-13/h1-9H,(H,23,24,25)/b15-9- | | InChIKey | RJPNRXFBYZVRIB-DHDCSXOGSA-N | | SMILES | ClC(C=CC=C1Cl)=C1NC2=NC(/C(S2)=C/C3=CC4=C(N=CC=N4)C=C3)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | GSK-626616 Usage And Synthesis |
| Uses | GSK-626616 is a potent and selective DYRK inhibitor (IC50 = 0.7 nM for DYRK3, similar potency for DYRK1 and 2). Exhibits ~20-fold selectivity over casein kinase 2 and negligible activity against a panel of 451 kinases screened. Enhances number of CFU-E stimulated by Epo from human marrow. Increases hemoglobin levels in anemic mice. Orally bioavailable. | | Biological Activity | GSK626616 is an orally available, ATP-competitive, potent and selective dual-specificity tyrosine phosphorylation-regulated kinase DYRK inhibitor (DYRK3 IC50 = 0.7 nM; similar potency against DYRK1A and DYRK2) with 20-fold selectivity over the closed related casein kinase 2. GSK626616 enhances Epo-stimulated increase of human marrow erythroid colony formation units (CFU-E), without affecting megakaryocyte colony growth or CFU-GM formation. GSK626616 enhances the percentage and number of Ter119+/CD71+ erythroid progenitors derived from kit+ mouse marrow in the presence of SCF and Epo in cultures, and exhibits therapeutic efficacy in a murine anemia model in vivo (0.03 mg/kg/d i.p.) | | IC 50 | DYRK1; DYRK2; DYRK3 | | storage | Store at +4°C |
| | GSK-626616 Preparation Products And Raw materials |
|