|
|
| | 5-O-Feruloylquinic acid Basic information |
| Product Name: | 5-O-Feruloylquinic acid | | Synonyms: | 5-O-Feruloylquinic acid;Cyclohexanecarboxylic acid, 1,3,4-trihydroxy-5-[[3-(4-hydroxy-3-methoxyphenyl)-1-oxo-2-propen-1-yl]oxy]-, (1R,3R,4S,5R)-;5-FQA;5-Feruloylquinic acid,5 Feruloylquinic acid,inhibit,Tyrosinase,5Feruloylquinic acid,Inhibitor;(1R,3R,4S,5R)-1,3,4-trihydroxy-5-((3-(4-hydroxy-3-methoxyphenyl)acryloyl)oxy)cyclohexanecarboxylic acid;(1R,3R,4S,5R)-1,3,4-Trihydroxy-5-((3-(4-hydroxy-3-methoxyphenyl)acryloyl)oxy)cyclohexane-1-carboxylic acid | | CAS: | 40242-06-6 | | MF: | C17H20O9 | | MW: | 368.34 | | EINECS: | | | Product Categories: | | | Mol File: | 40242-06-6.mol |  |
| | 5-O-Feruloylquinic acid Chemical Properties |
| Melting point | 199-200 °C(Solv: water (7732-18-5)) | | Boiling point | 629.4±55.0 °C(Predicted) | | density | 1.53±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO: soluble | | pka | 3.91±0.50(Predicted) | | form | A solid | | color | White to off-white | | Major Application | food and beverages
pharmaceutical | | InChIKey | RAGZUCNPTLULOL-JSHWQEIDSA-N | | SMILES | [C@]1(O)(C(O)=O)C[C@@H](OC(=O)C=CC2=CC=C(O)C(OC)=C2)[C@@H](O)[C@H](O)C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 5-O-Feruloylquinic acid Usage And Synthesis |
| Uses | 5-O-Feruloylquinic Acid is a derivative of quinic acid and a constituent of coffee beans. Studies showed that coffee polyphenols is able to suppress fat accumulation by downregulating SREBP-1c in mice. | | Definition | ChEBI: 3-Feruloylquinic acid is a quinic acid. |
| | 5-O-Feruloylquinic acid Preparation Products And Raw materials |
|