| Company Name: |
Hangzhou Oder Technology Co., Ltd. Gold
|
| Tel: |
0571-88772972-0 15057128248 |
| Email: |
2746615063@qq.com |
| Products Intro: |
Product Name:2-Bromo-3-tetradecylthiophene CAS:500199-09-7 Purity:98% Package:1g;5g;10g;20g;50g;100g Remarks:BB15030
|
| Company Name: |
TOKYO CHEMICAL INDUSTRY CO., LTD.
|
| Tel: |
03-36680489 |
| Email: |
Sales-JP@TCIchemicals.com |
| Products Intro: |
Product Name:2-Bromo-3-tetradecylthiophene CAS:500199-09-7 Purity:95-98% Package:1 g,5 g
|
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
| Products Intro: |
Product Name:2-Bromo-3-tetradecylthiophene CAS:500199-09-7 Purity:95-98% Package:1 g,5 g
|
|
| | 2-Bromo-3-tetradecylthiophene Basic information | | Uses |
| | 2-Bromo-3-tetradecylthiophene Chemical Properties |
| Boiling point | 399.9±22.0 °C(Predicted) | | density | 1.102±0.06 g/cm3(Predicted) | | refractive index | 1.6660 to 1.6700 | | form | clear liquid | | color | Colorless to Red to Green | | InChI | InChI=1S/C18H31BrS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-15-16-20-18(17)19/h15-16H,2-14H2,1H3 | | InChIKey | GOUPSYVDGUEWMF-UHFFFAOYSA-N | | SMILES | C1(Br)SC=CC=1CCCCCCCCCCCCCC |
| | 2-Bromo-3-tetradecylthiophene Usage And Synthesis |
| Uses | 2-Bromo-3-tetradecylthiophene is a useful research chemical. |
| | 2-Bromo-3-tetradecylthiophene Preparation Products And Raw materials |
|