|
|
| | (R)-(+)-1-Boc-3-aminopyrrolidine Basic information |
| | (R)-(+)-1-Boc-3-aminopyrrolidine Chemical Properties |
| Melting point | 243-244°C | | Boiling point | 243-244°C | | density | 1.098 | | refractive index | 1.4720 | | Fp | 196°F | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | form | Liquid | | pka | 9.55±0.20(Predicted) | | color | Clear pale yellow | | Sensitive | Air Sensitive | | InChI | InChI=1S/C9H18N2O2/c1-9(2,3)13-8(12)11-5-4-7(10)6-11/h7H,4-6,10H2,1-3H3/t7-/m1/s1 | | InChIKey | CMIBWIAICVBURI-SSDOTTSWSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CC[C@@H](N)C1 | | CAS DataBase Reference | 147081-49-0(CAS DataBase Reference) |
| Hazard Codes | C,Xn | | Risk Statements | 22-41-44 | | Safety Statements | 26-36/37/39 | | RIDADR | UN 2810 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | Ⅲ | | HS Code | 29339900 |
| | (R)-(+)-1-Boc-3-aminopyrrolidine Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liqui | | Uses | (R)-(+)-1-Boc-3-aminopyrrolidine may be used to prepare:
- Descarboxamide analog and Na-methylated analogs of 4-N-(Nω-nitro-L-argininyl)-trans-4-amino-L-proline amide.
- Histamine 3 (H3) receptor antagonists containing pyrrolidin-3-yl-N-methylbenzamide moiety.
| | Synthesis | A mixture of tert-butyl (R)-3-azido pyrrolidine-1-carboxylate (250 mg, 1.18 mmol) and Pd/C (50 mg, 10% w/w) in methanol (10 mL) was reacted with stirring at room temperature for 12 h under hydrogen atmosphere. Upon completion of the reaction, the catalyst was removed by filtration and the filtrate was concentrated to afford tert-butyl (R)-3-aminopyrrolidine-1-carboxylate as a colorless liquid (210 mg, 96% yield). The product was characterized by 1H NMR (600 MHz, CDCl3): δ 3.33-3.49 (m, 3H), 3.27-3.32 (m, 1H), 2.95-3.03 (m, 1H), 1.98-2.08 (m, 1H), 1.63-1.70 (m, 1H), 1.41 (s, 9H). Mass spectrometry (MS-ESI) analysis showed: m/z 131.20 [M-55]+. | | References | [1] Patent: WO2016/34134, 2016, A1. Location in patent: Paragraph 00508
[2] Patent: CN105399698, 2016, A. Location in patent: Paragraph 1493-1495
[3] Patent: US2009/221565, 2009, A1. Location in patent: Page/Page column 50
[4] Advanced Synthesis and Catalysis, 2009, vol. 351, # 14-15, p. 2288 - 2294
[5] Tetrahedron, 2009, vol. 65, # 41, p. 8513 - 8523 |
| | (R)-(+)-1-Boc-3-aminopyrrolidine Preparation Products And Raw materials |
|