- FMOC-LYS(BIOTIN)-OH
-
- $6662.00 / 1KG
-
2025-12-24
- CAS: 146987-10-2
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 1T
- FMOC-LYS(BIOTIN)-OH
-
- $6662.00 / 1KG
-
2025-12-24
- CAS: 146987-10-2
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 1T
|
| | FMOC-LYS(BIOTIN)-OH Basic information |
| Product Name: | FMOC-LYS(BIOTIN)-OH | | Synonyms: | FMOC-LYS(BIOTIN)-OH 95+%;Fmoc-Lys(Biotin)-OH(N-a-Fmoc-N-e-(d-Biotin)-L-lysine;nα-fmoc-nε-biotinyl-l-lysine;ε-Biotinoyl-α-(9-fluorenylmethoxycarbonyl)-L-lysine;Fmoc-Lys(biotinyl)-OH, Nα-Biotinyl-Nε-Fmoc-L-lysine;N-(9-Fluorenylmethyloxycarbonyl)-N'-biotinyl-L-lysine;N^a-Biotinyl-N^e-FMoc-L-lysine, 95%;Nα-FMoc-Nε-biotinyl-L-lysine | | CAS: | 146987-10-2 | | MF: | C31H38N4O6S | | MW: | 594.72 | | EINECS: | | | Product Categories: | Amino Acids | | Mol File: | 146987-10-2.mol |  |
| | FMOC-LYS(BIOTIN)-OH Chemical Properties |
| Melting point | 178-180 °C(Solv: methanol (67-56-1); N,N-dimethylformamide (68-12-2)) | | Boiling point | 936.2±65.0 °C(Predicted) | | density | 1.271±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | solubility | DMSO (Slightly, Heated) | | pka | 3.88±0.21(Predicted) | | form | Solid | | color | White to Off-White | | Optical Rotation | 18.6°(C=0.01g/mL, DMSO, 20°C, 589nm) | | Water Solubility | Slightly soluble in water and dimethyl sulfoxide. | | Major Application | peptide synthesis | | InChIKey | OFIBQNGDYNGUEZ-OBXRUURASA-N | | SMILES | C(O)(=O)[C@H](CCCCNC(=O)CCCC[C@H]1[C@@]2([H])NC(=O)N[C@@]2([H])CS1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | | CAS DataBase Reference | 146987-10-2(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | HS Code | 2934 99 90 | | Storage Class | 11 - Combustible Solids |
| | FMOC-LYS(BIOTIN)-OH Usage And Synthesis |
| Chemical Properties | Beige powder | | Uses | Nα-Fmoc-Nε-biotinyl-L-lysine is useful in the synthesis of site-specific biotinylated probes. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-LYS(BIOTIN)-OH Preparation Products And Raw materials |
|