- 4-Allyoxystyrene
-
-
2025-06-04
- CAS:16215-47-7
- Min. Order: 1kg
- Purity: 98%+
- Supply Ability: 10000kg per Month
|
| | 4-Allyoxystyrene Basic information |
| Product Name: | 4-Allyoxystyrene | | Synonyms: | 4-Allyoxystyrene;Benzene, 1-ethenyl-4-(2-propen-1-yloxy)-;3-(4-Vinylphenyloxy)-1-propene;4-Allyoxystyrene
CAS | | CAS: | 16215-47-7 | | MF: | C11H12O | | MW: | 160.21 | | EINECS: | | | Product Categories: | | | Mol File: | 16215-47-7.mol |  |
| | 4-Allyoxystyrene Chemical Properties |
| Boiling point | 82-83 °C(Press: 1 Torr) | | density | 0.956±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C11H12O/c1-3-9-12-11-7-5-10(4-2)6-8-11/h3-8H,1-2,9H2 | | InChIKey | ZSZUAWYMYCAJNX-UHFFFAOYSA-N | | SMILES | C1(C=C)=CC=C(OCC=C)C=C1 |
| | 4-Allyoxystyrene Usage And Synthesis |
| | 4-Allyoxystyrene Preparation Products And Raw materials |
|