|
|
| | 4,4'-DIPYRIDYLAMINE Basic information | | Uses |
| Product Name: | 4,4'-DIPYRIDYLAMINE | | Synonyms: | 4,4'-DIPYRIDYLAMINE;4,4'-Iminodi-pyridine;DI-4-PYRIDINAMINE;DI-4-PYRIDYLAMINE;N-4-Pyridinyl-4-pyridinamine;4,4'-Dipyridylamine
Di-4-pyridylamine;N-pyridin-4-ylpyridin-4-amine;NSC 15067 | | CAS: | 1915-42-0 | | MF: | C10H9N3 | | MW: | 171.2 | | EINECS: | | | Product Categories: | | | Mol File: | 1915-42-0.mol |  |
| | 4,4'-DIPYRIDYLAMINE Chemical Properties |
| Melting point | 281-282℃ | | Boiling point | 354℃ | | density | 1.206 | | Fp | 168℃ | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder to crystal | | pka | 6.76±0.26(Predicted) | | color | White to Green to Brown | | InChI | InChI=1S/C10H9N3/c1-5-11-6-2-9(1)13-10-3-7-12-8-4-10/h1-8H,(H,11,12,13) | | InChIKey | KDWIKPVYQSPYIX-UHFFFAOYSA-N | | SMILES | C1=NC=CC(NC2C=CN=CC=2)=C1 |
| | 4,4'-DIPYRIDYLAMINE Usage And Synthesis |
| Uses | 4,4'-Dipyridylamine is a pyridine derivative that can be used in organic and pharmaceutical synthesis experiments. |
| | 4,4'-DIPYRIDYLAMINE Preparation Products And Raw materials |
|