|
|
| | 2,3,5,6-TETRAFLUORO-4-METHYLBENZOIC ACID Basic information |
| Product Name: | 2,3,5,6-TETRAFLUORO-4-METHYLBENZOIC ACID | | Synonyms: | 2,3,5,6-Tetrafluoro-p-toluic acid,98%;benzoic acid, 2,3,5,6-tetrafluoro-4-methyl-;4-Carboxy-2,3,5,6-tetrafluorotoluene, 2,3,5,6-Tetrafluoro-p-toluic acid;2,3,5,6-Tetrafluoro-p-toluic acid 98%;2,3,5,6-TETRAFLUORO-4-METHYLBENZOIC ACID;2,3,5,6-TETRAFLUORO-P-TOLUIC ACID;4-Methyl-2,3,5,6-tetrafluorobenzoic acid;sodium 4-(1-ethoxy-3-phenoxypropan-2-yl)oxy-4-oxobutanoate | | CAS: | 652-32-4 | | MF: | C8H4F4O2 | | MW: | 208.11 | | EINECS: | | | Product Categories: | C8;Carbonyl Compounds;Carboxylic Acids | | Mol File: | 652-32-4.mol |  |
| | 2,3,5,6-TETRAFLUORO-4-METHYLBENZOIC ACID Chemical Properties |
| Melting point | 173-175 °C(lit.) | | Boiling point | 255.8±35.0 °C(Predicted) | | density | 1.4412 (estimate) | | storage temp. | Store at room temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 1.83±0.10(Predicted) | | color | White to Gray to Brown | | InChI | 1S/C8H4F4O2/c1-2-4(9)6(11)3(8(13)14)7(12)5(2)10/h1H3,(H,13,14) | | InChIKey | COOULIOYEXBFDT-UHFFFAOYSA-N | | SMILES | Cc1c(F)c(F)c(C(O)=O)c(F)c1F | | CAS DataBase Reference | 652-32-4(CAS DataBase Reference) |
| Hazard Codes | Xi,C | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Hazard Note | Corrosive | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,3,5,6-TETRAFLUORO-4-METHYLBENZOIC ACID Usage And Synthesis |
| Chemical Properties | white to almost white crystals or | | Uses | 2,3,5,6-Tetrafluoro-p-toluic acid may be used in chemical synthesis. |
| | 2,3,5,6-TETRAFLUORO-4-METHYLBENZOIC ACID Preparation Products And Raw materials |
|