| Company Name: |
Shanghai Anyinuo Biomedical Technology Co., Ltd. Gold
|
| Tel: |
021-34625901 18018851262; |
| Email: |
420970979@qq.com |
| Products Intro: |
Product Name:(R)-(5,5'-Dichloro-6,6'-dimethoxy-[1,1'-biphenyl]-2,2'-diyl)bis(diphenylphosphine)
CAS:185913-97-7
Purity:>=98% Package:100mg;250mg;500mg;1g;10g;100g;1kg
|
| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:(R)-(+)-5,5'-Dichloro-6,6'-dimethoxy-2,2'-bis(diphenylphosphino)-1,1'-biphenyl, min. 95% (R)-Cl-MeO-BIPHEP
CAS:185913-97-7
Purity:min. 95% Package:1g;250mg
|
|
| | (R)-(+)-5,5'-DICHLORO-6,6'-DIMETHOXY-2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'-BIPHENYL Basic information | | Description |
| Product Name: | (R)-(+)-5,5'-DICHLORO-6,6'-DIMETHOXY-2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'-BIPHENYL | | Synonyms: | (R)-(+)-5,5'-DICHLORO-6,6'-DIMETHOXY-2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'-BIPHENYL;(R)-CL-MEO-BIPHEP;(S)-(-)-5,5'-DICHLORO-6,6'-DIMETHOXY-2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'-BIPHENYL;(S)-CL-MEO-BIPHEP;(-)-2,2'-BIS(DIPHENYLPHOSPHINO)-5,5'-DICHLORO-6,6'-DIMETHOXY-1,1'-BIPHENYL;(+)-2,2'-BIS(DIPHENYLPHOSPHINO)-5,5'-DICHLORO-6,6'-DIMETHOXY-1,1'-BIPHENYL;(-)-5,5'-DICHLORO-2,2'-BIS(DIPHENYLPHOSPHINO)-6,6'-DIMETHOXY-1,1'-BIPHENYL;(+)-5,5'-DICHLORO-2,2'-BIS(DIPHENYLPHOSPHINO)-6,6'-DIMETHOXY-1,1'-BIPHENYL | | CAS: | 185913-97-7 | | MF: | C38H30Cl2O2P2 | | MW: | 651.5 | | EINECS: | | | Product Categories: | Chiral Phosphine;MeOBIPHEP Series | | Mol File: | 185913-97-7.mol |  |
| | (R)-(+)-5,5'-DICHLORO-6,6'-DIMETHOXY-2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'-BIPHENYL Chemical Properties |
| Melting point | 176-180 °C | | Boiling point | 678.2±55.0 °C(Predicted) | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | form | Powder | | color | yellow-white | | Optical Rotation | [α]/D +59±4°, c = 1% in chloroform | | InChIKey | GCBRCSSVOVNEIX-UHFFFAOYSA-N | | SMILES | C1(C(OC)=C(C=CC=1P(C1=CC=CC=C1)C1C=CC=CC=1)Cl)C1=C(OC)C(=CC=C1P(C1=CC=CC=C1)C1C=CC=CC=1)Cl |
| Safety Statements | 24/25 | | WGK Germany | 3 | | F | 10-23 | | Storage Class | 11 - Combustible Solids |
| | (R)-(+)-5,5'-DICHLORO-6,6'-DIMETHOXY-2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'-BIPHENYL Usage And Synthesis |
| Description | 1. Ligand used in the ruthenium catalyzed, enantioselective hydrogenation of alkenes, carbonyls, and imines.
2. Ligand used in the rhodium-catalyzed cyclization of acetylenic aldehydes.
3. Ligand used in the iridium-catalyzed hydrogenative coupling of alkynes to aromatic and aliphatic N-arylsulfonyl aldimines.
4. Asymmetric Cu-catalyzed propargylic substitution with amines,4a and enamines.4b
5. Catalytic desymmetrizing intramolecular Heck reaction.
6. Assembly of 1,3-polyols.
7. Pd-catalyzed diastereo/enantioselective allylic alkylations of ketone enolates.
8. Enantioselective vinylogous Reformatsky-type addition.
9. Cu-catalyzed chemoselective preparation of 2-(pinacolato)boron- substituted allylcopper complexes.
and their In situ site-, diastereo-, and enantioselective additions to ketones.
 |
| | (R)-(+)-5,5'-DICHLORO-6,6'-DIMETHOXY-2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'-BIPHENYL Preparation Products And Raw materials |
|