|
|
| | (2R,3S)-3-(tert-Butoxycarbonyl)amino-1,2-epoxy-4-phenylbutane Basic information |
| Product Name: | (2R,3S)-3-(tert-Butoxycarbonyl)amino-1,2-epoxy-4-phenylbutane | | Synonyms: | (2R, 3S)-1,2-EPOXY-3-N-(TERT-BUTOXYCARBONYL)AMINO-4-PHENYLBUTANE;(2r,3s)-3-(n-boc-amino)-1-oxirane-4-phenylbutane;(2R,3S)-3-(tert-Butoxycarbonyl)amino-1,2-epoxy-4-phenylbutane;[1(S)-BENZYL-2(R),3-EPOXYPROPYL]-CARBAMIC ACID TERT-BUTYL ESTER;THREO-N-BOC-L-PHENYLALANINE EPOXIDE;TERT-BUTYL (1S)-1-[(2R)-OXIRAN-2-YL]-2-PHENYLETHYLCARBAMATE;Tert-Butyl[(1S)-1-(2R)-Oxiranyl-2-Phenylethyl]carbamate;Carbamic acid,[(1S)-1-(2R)-oxiranyl-2-phenylethyl]-,1,1-dimethylethyl ester | | CAS: | 98760-08-8 | | MF: | C15H21NO3 | | MW: | 263.34 | | EINECS: | 619-374-7 | | Product Categories: | Heterocycles;chiral;Chiral Amino Epoxides;Aromatics Compounds;Aromatics;Chiral Reagents | | Mol File: | 98760-08-8.mol |  |
| | (2R,3S)-3-(tert-Butoxycarbonyl)amino-1,2-epoxy-4-phenylbutane Chemical Properties |
| Melting point | 50-52°C | | Boiling point | 398.8±25.0 °C(Predicted) | | density | 1.118±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | pka | 12.19±0.46(Predicted) | | form | Solid | | color | White to Off-White | | Optical Rotation | Consistent with structure | | InChI | InChI=1/C15H21NO3/c1-15(2,3)19-14(17)16-12(13-10-18-13)9-11-7-5-4-6-8-11/h4-8,12-13H,9-10H2,1-3H3,(H,16,17)/t12-,13-/s3 | | InChIKey | NVPOUMXZERMIJK-NYZMZBMTNA-N | | SMILES | [C@H]([C@@]1([H])OC1)(NC(=O)OC(C)(C)C)CC1C=CC=CC=1 |&1:0,1,r| | | CAS DataBase Reference | 98760-08-8(CAS DataBase Reference) |
| | (2R,3S)-3-(tert-Butoxycarbonyl)amino-1,2-epoxy-4-phenylbutane Usage And Synthesis |
| Chemical Properties | White Crystalline Powder | | Uses | Atazanavir intermediate. Enantiomer R | | Application | (2R,3S)-3-(tert-Butoxycarbonyl)amino-1,2-epoxy-4-phenylbutane is an intermediate of the HIV-1 protease inhibitor atazanavir (sc-207305) and aslo an intermediate of amprenavir. |
| | (2R,3S)-3-(tert-Butoxycarbonyl)amino-1,2-epoxy-4-phenylbutane Preparation Products And Raw materials |
|