|
|
| | 2-Amino-4,6-dihydroxypyrimidine Basic information |
| | 2-Amino-4,6-dihydroxypyrimidine Chemical Properties |
| Melting point | >300 °C (lit.) | | Boiling point | 235.85°C (rough estimate) | | density | 1.4748 (rough estimate) | | refractive index | 1.5000 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | Soluble in Aqueous Alkali. | | pka | 7.45±0.10(Predicted) | | form | Powder | | color | Off-white to light pink or light yellow | | BRN | 510297 | | InChI | InChI=1S/C4H5N3O2/c5-4-6-2(8)1-3(9)7-4/h1H,(H4,5,6,7,8,9) | | InChIKey | AUFJTVGCSJNQIF-UHFFFAOYSA-N | | SMILES | C1(N)=NC(O)=CC(=O)N1 | | CAS DataBase Reference | 56-09-7(CAS DataBase Reference) | | EPA Substance Registry System | 2-Amino-6-hydroxy-4(1H)-pyrimidinone (56-09-7) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 24/25-36-26 | | WGK Germany | 1 | | RTECS | UW7361000 | | TSCA | TSCA listed | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | 2-Amino-4,6-dihydroxypyrimidine Usage And Synthesis |
| Description | 2-Amino-4,6-dihydroxypyrimidine is a hydroxypyrimidine. | | Chemical Properties | White Solid | | Uses | 2-Amino-4,6-dihydroxypyrimidine acts as an intermediate in the production of antimicrobial guanylsulfonamides. It also acts as an intermediate in pharmaceuticals and agrochemicals. | | Definition | ChEBI: 2-Amino-4,6-dihydroxypyrimidine is a hydroxypyrimidine. | | Synthesis | The synthesis of 2-Amino-4,6-dihydroxypyrimidine is as follows:
A freshly-prepared sodiummethoxide solution in methanol (25 ml) was added to a round-bottomed flask containing guanidine hydrochloride(15 mmol), stirred for a few minutes, before dimethyl malonate (15 mmol)was slowly added. The mixture was heated under reflux for about 2-3hours. After evaporation of the solvent under reduced pressure, the resultingwhite solid was dissolved in a minimum amount of water and the pH adjusted to 6with 10% HCl. The precipitate obtained was filtered and washed with distilledwater and ethanol, respectively, to obtain pure 2-amino-4,6-pyrimidinediol.(Note: sodium methoxide solution was prepared by addition of small pieces ofsodium metal in methanol).Yield: 85%;solid, m.p. 195-197 °C.
 | | References | [1] Patent: CN106167469, 2016, A. Location in patent: Paragraph 0012; 0013; 0014 |
| | 2-Amino-4,6-dihydroxypyrimidine Preparation Products And Raw materials |
|