| Company Name: |
Shanghai HC Biotech Co., Ltd
|
| Tel: |
021-20227858 |
| Email: |
sale@hcbiotech.com.cn |
| Products Intro: |
Product Name:Boc-L-2-Furylalanine.DCHA CAS:331730-08-6 Purity:98%+ Package:1g;5g;100g;1KG
|
| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Products Intro: |
Product Name:N-Boc-3-(2-furyl)-L-alanine dicyclohexylaMMoniuM salt, 98% CAS:331730-08-6 Package:250Mg Remarks:H62258
|
|
| | BOC-L-2-FURYLALANINE DCHA SALT Basic information |
| | BOC-L-2-FURYLALANINE DCHA SALT Chemical Properties |
| storage temp. | Inert atmosphere,2-8°C | | form | Powder | | color | White | | Major Application | peptide synthesis | | InChIKey | QYEOQPFAYJEDFE-FVGYRXGTSA-N | | SMILES | C1CCC(CC1)NC2CCCCC2.CC(C)(C)OC(=O)N[C@@H](Cc3ccco3)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | BOC-L-2-FURYLALANINE DCHA SALT Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-L-2-FURYLALANINE DCHA SALT Preparation Products And Raw materials |
|