- 2-Bromo-5-nitropyridine
-
- $0.00 / 25KG
-
2025-12-01
- CAS:4487-59-6
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10000KGS
- 2-Bromo-5-nitropyridine
-
- $6.00 / 1KG
-
2025-09-25
- CAS:4487-59-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 2-Bromo-5-nitropyridine Basic information |
| | 2-Bromo-5-nitropyridine Chemical Properties |
| Melting point | 139-141 °C (lit.) | | Boiling point | 145-147 °C/10 mmHg (lit.) | | density | 1.8727 (rough estimate) | | refractive index | 1.6200 (estimate) | | Fp | 145-147°C/10mm | | storage temp. | Inert atmosphere,2-8°C | | solubility | Chloroform, Hot Methanol | | pka | -3.24±0.10(Predicted) | | form | Crystalline Powder | | color | Light yellow to light brown | | Water Solubility | Insoluble in water. | | BRN | 120901 | | InChI | InChI=1S/C5H3BrN2O2/c6-5-2-1-4(3-7-5)8(9)10/h1-3H | | InChIKey | HUUFTVUBFFESEN-UHFFFAOYSA-N | | SMILES | C1(Br)=NC=C([N+]([O-])=O)C=C1 | | CAS DataBase Reference | 4487-59-6(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38-20/21/22 | | Safety Statements | 26-37/39-22-36 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant/Keep Cold | | HazardClass | IRRITANT, IRRITANT-HARMFUL | | PackingGroup | III | | HS Code | 29333990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Bromo-5-nitropyridine Usage And Synthesis |
| Chemical Properties | Off-white to light yellow crystal. | | Uses | 2-Bromo-5-nitropyridine was used in preparation of boc-protected (piperazin-1-ylmethyl)biaryls via microwave-mediated Suzuki-Miyaura coupling with (boc-piperazin-1-ylmethyl)phenylboronic acid pinacol esters. It was also used in the synthesis of 2-pyridyl analogs. Substituted 5-nitro-2-ethynylpyridines were synthesized by the Sonogashira reaction of 2-bromo-5-5-nitropyridine with terminal acetylenes. |
| | 2-Bromo-5-nitropyridine Preparation Products And Raw materials |
|