|
|
| | 2-Bromo-5-nitropyridine Basic information | | Synthesis |
| | 2-Bromo-5-nitropyridine Chemical Properties |
| Melting point | 139-141 °C (lit.) | | Boiling point | 145-147 °C/10 mmHg (lit.) | | density | 1.8727 (rough estimate) | | refractive index | 1.6200 (estimate) | | Fp | 145-147°C/10mm | | storage temp. | Inert atmosphere,2-8°C | | solubility | Chloroform, Hot Methanol | | form | Crystalline Powder | | pka | -3.24±0.10(Predicted) | | color | Light yellow to light brown | | Water Solubility | Insoluble in water. | | BRN | 120901 | | InChI | InChI=1S/C5H3BrN2O2/c6-5-2-1-4(3-7-5)8(9)10/h1-3H | | InChIKey | HUUFTVUBFFESEN-UHFFFAOYSA-N | | SMILES | C1(Br)=NC=C([N+]([O-])=O)C=C1 | | CAS DataBase Reference | 4487-59-6(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38-20/21/22 | | Safety Statements | 26-37/39-22-36 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant/Keep Cold | | HazardClass | IRRITANT, IRRITANT-HARMFUL | | PackingGroup | III | | HS Code | 29333990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Bromo-5-nitropyridine Usage And Synthesis |
| Synthesis | 
A mixture of 1.53 g (10.94 mmol) of 2-hydroxy-5-nitropyridine, 4.1 g (12.71 mmol) of tetrabutylammonium bromide, and 3.71 g (26.1 mmol) of P2O5 in 29 ml of benzene was heated and stirred under reflux for 1 hour. The mixture was cooled to room temperature, the upper layer was separated by decantation, and the lower layer was ground with benzene (3 × 6 ml). The extract was combined with the organic phase, washed with saturated solutions of NaHCO3 and NaCl, and dried over MgSO4. The solvent was distilled off under reduced pressure, and the residue was recrystallized from petroleum ether. Yield: 1.7 g (48%). Mp: 138-139°C (bp: 40-70°C). | | Chemical Properties | Off-white to light yellow crystal. | | Uses | 2-Bromo-5-nitropyridine was used in preparation of boc-protected (piperazin-1-ylmethyl)biaryls via microwave-mediated Suzuki-Miyaura coupling with (boc-piperazin-1-ylmethyl)phenylboronic acid pinacol esters. It was also used in the synthesis of 2-pyridyl analogs. Substituted 5-nitro-2-ethynylpyridines were synthesized by the Sonogashira reaction of 2-bromo-5-5-nitropyridine with terminal acetylenes. |
| | 2-Bromo-5-nitropyridine Preparation Products And Raw materials |
|